3-μεθυλοπεντάνιο

Από τη Βικιπαίδεια, την ελεύθερη εγκυκλοπαίδεια
Μετάβαση σε: πλοήγηση, αναζήτηση
3-μεθυλοπεντάνιο
3-methylpentane.png
3-methylpentane.PNG
3-Methylpentane-3D-balls.png
3-Methylpentane-3D-spacefill.png
Γενικά
Όνομα IUPAC 3-μεθυλοπεντάνιο
Χημικά αναγνωριστικά
Χημικός τύπος C6H14
Μοριακή μάζα 86,18 amu
Σύντομος
συντακτικός τύπος
CH3CH2CH(CH3)CH2CH3
Συντομογραφίες sBuΕτ
Αριθμός CAS 96-14-0
SMILES CCC(C)CC
Ισομέρεια
Ισομερή θέσης 4
εξάνιο
2-μεθυλοπεντάνιο
2,2-διμεθυλοβουτάνιο
2,3-διμεθυλοβουτάνιο
Φυσικές ιδιότητες
Σημείο τήξης -118 °C
Σημείο βρασμού 64 °C
Εμφάνιση Άχρωμο υγρό
Χημικές ιδιότητες
Επικινδυνότητα
Hazard F.svg Hazard X.svg Hazard N.svg
Εξαιρετικά εύφλεκτο (F+), Επιβλαβές (Xn), Τοξικό για τους υδρόβιους οργανισμούς (N)
Φράσεις κινδύνου 12, 51/53, 65, 66, 67
Φράσεις ασφαλείας 2, 9, 16, 29, 33, 61, 62
Εκτός αν σημειώνεται διαφορετικά, τα δεδομένα αφορούν υλικά υπό κανονικές συνθήκες (25°C, 100 kPa).

Το 3-μεθυλοπεντάνιο είναι ένα αλκάνιο δηλαδή άκυκλος κορεσμένος υδρογονάνθρακας, με χημικό τύπο C6H14 και σύντομο συντακτικό τύπο CH3CH2CH(CH3)CH2CH3.

Ονοματολογία[Επεξεργασία | επεξεργασία κώδικα]

Η ονομασία «3-μεθυλοπεντάνιο» από την ονοματολογία κατά IUPAC. Συγκεκριμένα, το αρχικό πρόθεμα «μεθυλο-» δηλώνει την παρουσία διακλάδωσης ενός (1) ατόμου άνθρακα και συγκεκριμένα στο άτομο άνθρακα #3, όπως δηλώνει ο αρχικός αριθμός θέσης, το τμήμα «πεντ-» δηλώνει την παρουσία πέντε (5) ατόμων άνθρακα στην κύρια ανθρακική αλυσίδα της ένωσης, το ενδιάμεσο «-αν-» δείχνει την παρουσία μόνο απλών δεσμών μεταξύ ατόμων άνθρακα στο μόριο και η κατάληξη «-ιο» φανερώνει ότι δεν περιέχει χαρακτηριστικές ομάδες, δηλαδή ότι είναι υδρογονάνθρακας.

Δομή[Επεξεργασία | επεξεργασία κώδικα]

Το μόριό του αποτελείται από έξι (6) άτομα άνθρακα (τρία (3) πρωτοταγή,[1] δύο (2) δευτεροταγή[2]) και ένα (1) τριτοταγές[3])) και δεκατέσσερα (14) άτομα υδρογόνου. Δομικά, το κάθε ακραίο άτομο άνθρακα βρίσκεται στο κέντρο ενός τετραέδρου και τα τρία (3) άτομα υδρογόνου και το έτερο άτομο άνθρακα στις κορυφές του. Για τα κεντρικό άτομο άνθρακα, η διαφορά είναι ότι είναι συνδεμένο με ένα (1) άτομο υδρογόνου και τρία (3) άτομα άνθρακα Οι δεσμοί C-H που σχηματίζονται είναι ελαφρά πολωμένοι (~3%) ομοιοπολικοί τύπου σ (2sp3-1s), με μήκος 108,7 pm. Ο δεσμός C-C είναι ομοιοπολικός τύπου σ (2sp3-2sp3), με μήκος 154 pm. Οι δε γωνίες \mathrm{\widehat{H C H}} είναι περίπου 109° 28΄.

Δεσμοί[4]
Δεσμός τύπος δεσμού ηλεκτρονική δομή Μήκος δεσμού Ιονισμός
C-H σ 2sp3-1s 109 pm 3% C- H+
C-C σ 2sp3-2sp3 154 pm
Κατανομή φορτίων
σε ουδέτερο μόριο
C#1,#5,#1' -0,09
C#2,#4 -0,06
C#3 -0,03
H +0,03

Παραγωγή[Επεξεργασία | επεξεργασία κώδικα]

Απομόνωση από φυσικές και βιομηχανικές πηγές[Επεξεργασία | επεξεργασία κώδικα]

  1. Απομονώνεται από το πετρέλαιο.
  2. Απομονώνεται από μίγματα που προκύπτουν από πυρόλυση βαρύτερων προϊόντων διύλισης πετρελαίου ή πολυμερών υδρογονανθράκων.

Παρασκευή με αντιδράσεις σύνθεσης: Από πρώτες ύλες με μικρότερη ανθρακική αλυσίδα[Επεξεργασία | επεξεργασία κώδικα]

1. Δομικά το 3-μεθυλοπεντάνιο αποτελείται από δυο μέρη: δευτεροταγές βουτύλιο (CH3CH2CHCH3) και αιθύλιο (CH3CH2). Επομένως, ο απλούστερος τρόπος παρασκευής καθαρού 3-μεθυλοπεντάνιου είναι η αντίδραση ζεύγους δευτεροταγές βουτυλαλογονιδίου - αιθυλολιθίου ή δευτεροταγές βουτυλολιθίου - αιθυλαλογονιδίου:[5]

\mathrm{CH_3CH_2CH_2XCH_3 + 2Li \xrightarrow{|Et_2O|} CH_3CH_2CH_2LiCH_3 + LiX}
\mathrm{CH_3CH_2X + CH_3CH_2CH_2XCH_3 \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + LiX}
ή
\mathrm{CH_3CH_2X + 2Li \xrightarrow{|Et_2O|} CH_3CH_2Li + LiX}
\mathrm{CH_3CH_2Li + CH_3CH_2CH_2XCH_3 \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + LiX}

2. Αν επιχειρηθεί η ανάλογη αντίδραση Wurtz το αποτέλεσμα είναι ένα μίγμα προϊόντων:[6]

\mathrm{CH_3CH_2X + CH_3CH_2CH_2XCH_3 + 6Na \xrightarrow{} CH_3CH_2CH_2CH_3 + CH_3CH_2CH(CH_3)CH_2CH_3 +}
 \mathrm{+ CH_3CH_2CH(CH_3)CHCH(CH_3)CH_2CH_3 + 6NaX}

  • Η αντίδραση είναι ασύμφορη σε σχέση με την προηγούμενη, αλλά τα προϊόντα αυτά διαχωρίζονται σχετικά εύκολα: Το βαρύτερο, το 3,4-διμεθυλοεξάνιο είναι υγρό (σ.ζ.: 164 °C)[7] στις ΣΣ[8] Το ζητούμενο (εδώ) 3-μεθυλοπεντάνιο είναι επίσης υγρό, αλλά πολύ πιο πτητικό (σ.ζ.: 64 °C) και το βουτάνιο είναι αέριο εύκολα υγροποιήσιμο με σχετικά μικρή ψύξη ή και με συμπίεση (σ.ζ.: -0,5 °C).

Παρασκευή με αντιδράσεις χωρίς αλλαγή ανθρακικής αλυσίδας[Επεξεργασία | επεξεργασία κώδικα]

Με αναγωγή αλογονούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

1. Με «υδρογόνο εν τω γεννάσθαι», δηλαδή μέταλλο + οξύ:[9]

 \mathrm{CH_3CH_2CH(CH_3)CH_2CH_2X + Zn + HX \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + ZnX_2}
ή
 \mathrm{CH_3CH_2CH(CH_3)CHXCH_3 + Zn + HX \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + ZnX_2}
ή
 \mathrm{CH_3CH_2CX(CH_3)CH_2CH_3 + Zn + HX \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + ZnX_2}
ή
 \mathrm{(CH_3CH_2)_2CHCH_2X + Zn + HX \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + ZnX_2}

2. Με LiAlH4 ή NaBH4:[10]

 \mathrm{4CH_3CH_2CH(CH_3)CH_2CH_2X + LiAlH_4 \xrightarrow{} 4CH_3CH_2CH(CH_3)CH_2CH_3 + AlX_3 + LiX}
ή
 \mathrm{4CH_3CH_2CH(CH_3)CHXCH_3 + Zn + HX + LiAlH_4 \xrightarrow{} 4CH_3CH_2CH(CH_3)CH_2CH_3 + AlX_3 + LiX}
ή
 \mathrm{4CH_3CH_2CX(CH_3)CH_2CH_3 + Zn + HX + LiAlH_4 \xrightarrow{} 4CH_3CH_2CH(CH_3)CH_2CH_3 + AlX_3 + LiX}
ή
 \mathrm{4(CH_3CH_2)_2CHCH_2X + Zn + HX + LiAlH_4 \xrightarrow{} 4CH_3CH_2CH(CH_3)CH_2CH_3 + AlX_3 + LiX}

3. Με αναγωγή των αντίστοιχων αλκυλιωδιδίων από HI:[11]

\mathrm{CH_3CH_2CH(CH_3)CH_2CH_2I + HI \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + I_2}
ή
\mathrm{CH_3CH_2CH(CH_3)CHICH_3 + HI \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + I_2}
ή
\mathrm{CH_3CH_2CI(CH_3)CH_2CH_3 + HI \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + I_2}
ή
\mathrm{(CH_3CH_2)_2CHCH_2I  + HI \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + I_2}

4. Με αναγωγή των κατάλληλων αλκυλαλογονιδίων από σιλάνιο, παρουσία τριφθοριούχου βορίου παράγεται βουτάνιo:[12]


\mathrm{CH_3CH_2CH(CH_3)CH_2CH_2X + SiH_4 \xrightarrow{BF_3} CH_3CH_2CH_2CH(CH_3)_2 + SiH_3X}
ή

\mathrm{CH_3CH_2CH(CH_3)CHXCH_3 + SiH_4 \xrightarrow{BF_3} CH_3CH_2CH_2CH(CH_3)_2 + SiH_3X}
ή

\mathrm{CH_3CH_2CX(CH_3)CH_2CH_3 + SiH_4 \xrightarrow{BF_3} CH_3CH_2CH_2CH(CH_3)_2 + SiH_3X}
ή

\mathrm{(CH_3CH_2)_2CHCH_2X + SiH_4 \xrightarrow{BF_3} CH_3CH_2CH_2CH(CH_3)_2 + SiH_3X}

5. Αναγωγή των κατάλληλων αλκυλαλογονιδίων από ένα αλκυλοκασσιτεράνιο. Π.χ.:[13]

\mathrm{CH_3CH_2CH(CH_3)CH_2CH_2X + RSnH_3 \xrightarrow{} CH_3CH_2CH_2CH(CH_3)_2 + RSnH_2X}
ή
\mathrm{CH_3CH_2CH(CH_3)CHXCH_3 + RSnH_3 \xrightarrow{} CH_3CH_2CH_2CH(CH_3)_2 + RSnH_2X}
ή
\mathrm{CH_3CH_2CX(CH_3)CH_2CH_3 + RSnH_3 \xrightarrow{} CH_3CH_2CH_2CH(CH_3)_2 + RSnH_2X}
ή
\mathrm{(CH_3CH_2)_2CHCH_2X + RSnH_3 \xrightarrow{} CH_3CH_2CH_2CH(CH_3)_2 + RSnH_2X}

6. Με αναγωγή από μέταλλα και στη συνέχεια υδρόλυση των παραγόμενων οργανομεταλλικών ενώσεων:

1. Με χρήση Li:[14]

\mathrm{CH_3CH_2CH(CH_3)CH_2CH_2X + 2Li \xrightarrow[-10^oC]{|Et_2O|} CH_3CH_2CH(CH_3)CH_2CH_2Li + LiX}
\mathrm{CH_3CH_2CH(CH_3)CH_2CH_2Li + H_2O \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + LiOH}
ή
\mathrm{CH_3CH_2CH(CH_3)CHXCH_3 + 2Li \xrightarrow[-10^oC]{|Et_2O|} CH_3CH_2CH(CH_3)CHLiCH_3 + LiX}
\mathrm{CH_3CH_2CH(CH_3)CHLiCH_3 + H_2O \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + LiOH}
ή
\mathrm{CH_3CH_2CX(CH_3)CH_2CH_3 + 2Li \xrightarrow[-10^oC]{|Et_2O|} CH_3CH_2CLi(CH_3)CH_2CH_3  + LiX}
\mathrm{CH_3CH_2CLi(CH_3)CH_2CH_3 + H_2O \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + LiOH}
ή
\mathrm{(CH_3CH_2)_2CHCH_2X + 2Li \xrightarrow[-10^oC]{|Et_2O|} (CH_3CH_2)_2CHCH_2Li  + LiX}
\mathrm{(CH_3CH_2)_2CHCH_2Li + H_2O \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + LiOH}

2. Με χρήση Mg:[15]

\mathrm{CH_3CH_2CH(CH_3)CH_2CH_2X + Mg \xrightarrow{|Et_2O|} CH_3CH_2CH(CH_3)CH_2CH_2MgX}
\mathrm{CH_3CH_2CH(CH_3)CH_2CH_2MgX + H_2O \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + Mg(OH)X}
ή
\mathrm{CH_3CH_2CH(CH_3)CHXCH_3 + Mg \xrightarrow{|Et_2O|} CH_3CH_2CH(CH_3)CHMgXCH_3}
\mathrm{CH_3CH_2CH(CH_3)CHMgXCH_3 + H_2O \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + Mg(OH)X}
ή
\mathrm{CH_3CH_2CX(CH_3)CH_2CH_3 + Mg \xrightarrow{|Et_2O|} CH_3CH_2CMgX(CH_3)CH_2CH_3}
\mathrm{CH_3CH_2CMgX(CH_3)CH_2CH_3  + H_2O \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + Mg(OH)X}
ή
\mathrm{(CH_3CH_2)_2CHCH_2X + Mg \xrightarrow{|Et_2O|} (CH_3CH_2)_2CHCH_2MgX}
\mathrm{(CH_3CH_2)_2CHCH_2MgX  + H_2O \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + Mg(OH)X}

Με υδρογόνωση ακόρεστων υδρογονανθράκων[Επεξεργασία | επεξεργασία κώδικα]

1. Από 3-μεθυλο-1-πεντένιο:[16]

 \mathrm{CH_3CH_2CH(CH_3)CH=CH_2 + H_2 \xrightarrow{Ni} CH_3CH_2CH(CH_3)CH_2CH_3}

2. Από 3-μεθυλο-2-πεντένιο:[16]

 \mathrm{CH_3CH_2C(CH_3)=CHCH_3 + H_2 \xrightarrow{Ni} CH_3CH_2CH(CH_3)CH_2CH_3}

3. Από 2-αιθυλο-1-βουτένιο:[16]

 \mathrm{(CH_3CH_2)_2C=CH_2 + H_2 \xrightarrow{Ni} CH_3CH_2CH(CH_3)CH_2CH_3}

4. Από 3-μεθυλο-1,2-πενταδιένιο:[16]

 \mathrm{CH_3CH_2C(CH_3)=C=CH_2 + 2H_2 \xrightarrow{Ni} CH_3CH_2CH(CH_3)CH_2CH_3}

5. Από 3-μεθυλο-1,3-πενταδιένιο:[16]

 \mathrm{CH_3CH=C(CH_3)CH=CH_2 + 2H_2 \xrightarrow{Ni} CH_3CH_2CH(CH_3)CH_2CH_3}

6. Από 3-μεθυλο-1,4-πενταδιένιο:[16]

 \mathrm{CH_2=CHCH(CH_3)CH=CH_2 + 2H_2 \xrightarrow{Ni} CH_3CH_2CH(CH_3)CH_2CH_3}

7. Από 3-μεθυλοπεντίνιο-1:[17]

 \mathrm{CH_3C_2HCH(CH_3)C \equiv CH + 2H_2 \xrightarrow{Ni} CH_3CH_2CH(CH_3)CH_2CH_3}

8. Από 3-μεθυλο-1,2,4-πεντατριένιο:[16]

 \mathrm{CH_2=CHC(CH_3)=C=CH_2 + 3H_2 \xrightarrow{Ni} CH_3CH_2CH(CH_3)CH_2CH_3}

9. Από 3-μεθυλο-4-πεντεν-2-ίνιο:[16][17]

 \mathrm{CH_3CH=C(CH_3)C \equiv CH + 3H_2 \xrightarrow{Ni} CH_3CH_2CH(CH_3)CH_2CH_3}

10. Από 3-μεθυλο-4-πεντεν-1-ίνιο:[16][17]

 \mathrm{CH_2=CHCH(CH_3)C \equiv CH + 3H_2 \xrightarrow{Ni} CH_3CH_2CH(CH_3)CH_2CH_3}

11. Από μεθυλοπενταδιενίνιο:[16][17]

 \mathrm{CH_2=C=C(CH_3)C \equiv CH + 4H_2 \xrightarrow{Ni} CH_3CH_2CH(CH_3)CH_2CH_3}

12. Από μεθυλοπενταδιίνιο:[17]

 \mathrm{CH \equiv CCH(CH_3)C \equiv CH + 4H_2 \xrightarrow{Ni} CH_3CH_2CH(CH_3)CH_2CH_3}

Με αναγωγή οξυγονούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

1. Με αναγωγή κατάλληλων αλδεϋδών - Αντίδραση Wolf-Kishner:[18]

1. Από 3-μεθυλοπεντανάλη:

 \mathrm{CH_3CH_2CH(CH_3)CH_2CHO + NH_2NH_2 \xrightarrow{KOH} CH_3CH_2CH(CH_3)CH_2CH_3 + N_2 + H_2O}

2. Από αιθυλοβουτανάλη:

 \mathrm{CH_3CH_2CH(CH_2CH_3)CHO + NH_2NH_2 \xrightarrow{KOH} CH_3CH_2CH(CH_3)CH_2CH_3 + N_2 + H_2O}

2. Με αναγωγή κατάλληλων κετονών - Αντίδραση Clemmensen[19]::

1. Από 3-μεθυλοπεντανόνη:

\mathrm{CH_3CH_2CH(CH_3)COCH_3 + 2Zn + 2HCl \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_3 + ZnCl_2 + ZnO}

Με αναγωγή θειούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

1. Με αναγωγή των κατάλληλων θειολών μπορεί να παραχθεί 3-μεθυλοπεντάνιο. Π.χ. από την αναγωγή της 3-μεθυλο-1-πεντανοθειόλης (μέθοδος Raney):[20]

\mathrm{CH_3CH_2CH(CH_3)CH_2CH_2SH + H_2 \xrightarrow{Ni} CH_3CH_2CH(CH_3)CH_2CH_3  + H_2S}

2. Με αναγωγή των κατάλληλων θειεστέρων μπορεί να παραχθεί 3-μεθυλοπεντάνιο.. Π.χ. από την αναγωγή του δι(3-μεθυλοπεντυλο)θειαιθέρα (μέθοδος Raney):[20]

\mathrm{CH_3CH_2CH(CH_3)CH_2CH_2SCH_2CH_2CH(CH_3)CH_2CH_3 + 2H_2 \xrightarrow{Ni} 2CH_3CH_2CH(CH_3)CH_2CH_3  + H_2S}

Παρασκευή με αντιδράσεις αποσύνθεσης με μείωση του μήκους της ανθρακικής αλυσίδας[Επεξεργασία | επεξεργασία κώδικα]

\mathrm{CH_3CH_2CH(CH_3)CH_2CH_2COOH + NaOH \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_2COONa + H_2O \xrightarrow{\mathcal{4}} CH_3CH_2CH_2CH(CH_3)CH_2CH_3 + NaHCO_3 \xrightarrow{\triangle} CH_3CH_2CH_2CH(CH_3)CH_2CH_3 + NaOH + CO_2}
ή
\mathrm{CH_3CH_2CH(CH_3)CH(CH_3)COOH + NaOH \xrightarrow{} CH_3CH_2CH(CH_3)CH(CH_3)COONa + H_2O \xrightarrow{\mathcal{4}} CH_3CH_2CH_2CH(CH_3)CH_2CH_3 + NaHCO_3 \xrightarrow{\triangle} CH_3CH_2CH_2CH(CH_3)CH_2CH_3 + NaOH + CO_2}
ή
\mathrm{CH_3CH_2C(CH_3)(CH_2CH_3)COOH + NaOH \xrightarrow{} CH_3CH_2C(CH_3)(CH_2CH_3)COONa + H_2O \xrightarrow{\mathcal{4}} CH_3CH_2CH_2CH(CH_3)CH_2CH_3 + NaHCO_3 \xrightarrow{\triangle} CH_3CH_2CH_2CH(CH_3)CH_2CH_3 + NaOH + CO_2}
ή
\mathrm{(CH_3CH_2)_2CHCH_2COOH + NaOH \xrightarrow{} CH_3CH_2)_2CHCH_2COONa + H_2O \xrightarrow{\mathcal{4}} CH_3CH_2CH_2CH(CH_3)CH_2CH_3 + NaHCO_3 \xrightarrow{\triangle} CH_3CH_2CH_2CH(CH_3)CH_2CH_3 + NaOH + CO_2}

Φυσικές ιδιότητες και ισομερή[Επεξεργασία | επεξεργασία κώδικα]

Το 3-μεθυλοπεντάνιο είναι άχρωμο υγρό με ελαφριά χαρακτηριστική οσμή. Ανήκει στην οικογένεια των αλκανίων. Με βάση το χημικό τύπο του (C6H12) προκύπτει ότι η ένωση σχηματίζει τέσσερα (4) ισομερή και συγκεκριμένα τα ακόλουθα:

  1. Εξάνιο: CH3(CH2)4CH3
  2. 2-μεθυλοπεντάνιο (ισοεξάνιο): CH3CH2CH2CH(CH3)2
  3. 2,2-διμεθυλοβουτάνιο (νεοεξάνιο): CH3CH2C(CH3)3
  4. 2,3-διμεθυλοβουτάνιο: (CH3)2CHCH(CH3)2
Συντακτικός τύπος
Δομή
Όνομα IUPAC
(ελληνική μορφή)
Όνομα
Μοριακό
Βάρος
Σημείο ζέσεως
(°C, 1 atm)
κ-εξάνιο κ-εξάνιο
εξάνιο
86,18 69
ισοεξάνιο 2-μεθυλοπεντάνιο
ισοεξάνιο
58,12 60
3-μεθυλοπεντάνιο 3-μεθυλοπεντάνιο 58,12 64
νεοεξάνιο 2,2-διμεθυλοβουτάνιο
νεοεξάνιο
58,12 49,73
2,3-διμεθυλοβουτάνιο 2,3-διμεθυλοβουτάνιο 58,12 57,9

Χημικές ιδιότητες[Επεξεργασία | επεξεργασία κώδικα]

Οξείδωση[Επεξεργασία | επεξεργασία κώδικα]

1. Τέλεια καύση: Όπως όλα τα αλκάνια, το 3-μεθυλοπεντάνιο με περίσσεια οξυγόνου καίγεται προς διοξείδιο του άνθρακα και νερό:[22]

 \mathrm{2C_6H_{14} + 19O_2 \xrightarrow{\triangle} 12CO_2 + 14H_2 + 8343 kJ}

  • Αν και η αντίδραση είναι μια έντονα εξώθερμη δεν συμβαίνει σε μέτριες θερμοκρασίες, γιατί για την έναρξή της πρέπει να υπερπηδηθεί πρώτα το εμπόδιο της διάσπασης των δεσμών C-C,[23] των δεσμών C-H[24] και των δεσμών (Ο=Ο)[25] του O2:

2. Παραγωγή υδραερίου:

\mathrm{C_6H_{14} + 6H_2O \xrightarrow[700-1100^oC]{Ni} 6CO + 14H_2}

3. Καταλυτική οξείδωση κυρίως προς 3-μεθυλοπεντανόλη-3:

\mathrm{CH_3CH_2CH(CH_3)CH_2CH_3 + \frac{1}{2}O_2 \xrightarrow[\triangle]{Cu} CH_3CH_2C(OH)(CH_3)CH_2CH_3}

4. Οξείδωση με υπερμαγγανικό κάλιο προς 3-μεθυλοπεντανόλη-3:

\mathrm{3CH_3CH_2CH(CH_3)CH_2CH_3 + 2KMnO_4 + H_2SO_4 \xrightarrow{} CH_3CH_2C(OH)(CH_3)CH_2CH_3 + 2MnO_2 + K_2SO_4 + H_2O}

Αλογόνωση[26][Επεξεργασία | επεξεργασία κώδικα]

 \mathrm{CH_3CH_2CH(CH_3)CH_2CH_3  + X_2 \xrightarrow[\triangle]{UV} aCH_3CH_2CH(CH_3)CH_2CH_2X + bCH_3CH_2CH(CH_3)CHXCH_3 + cCH_3CH_2CX(CH_3)CH_2CH_3 + dCH_3CH_2CH(CH_2X)CH_2CH_3 + HX}

  • Δραστικότητα των X2: F2 > Cl2 > Br2 > Ι2.
  • όπου 0<a,b,c,d<1, a + b + c + d = 0, διαφέρουν ανάλογα με το αλογόνο:
  • Τα F και Cl είναι πιο δραστικά και λιγότερο εκλεκτικά. Η αναλογία των προπυλαλογονιδίων τους εξαρτάται κυρίως πό τη στατιστική αναλογία των προς αντικατάσταση ατόμων H. Ειδικά για το χλώριο θα έχουμε:
Δηλαδή το μίγμα που προκύπτει είναι: 20,5% 3-μεθυλοπεντυλοχλωρίδιο-1, 52,1% 3-μεθυλοπεντυλοχλωρίδιο-2, 17,1% 3-μεθυλοπεντυλοχλωρίδιο-3 και 10,3% 2-αιθυλοβουτυλοχλωρίδιο-1.
  • Τα Br και I είναι πιο εκλεκτικά και λιγότερο δραστικά. Η αναλογία των πεντυλαλογονιδίων μεταβάλλεται προς όφελος του τριτοταγούς (αυτού που το αλογόνο συνδέεται με τριτοταγές άτομο C, δηλαδή ατόμου C ενωμένου με 3 άλλα άτομα C) 2-μεθυλοβουτυλοαλογονιδίου-2. Ειδικα για το βρώμιο θα έχουμε:
Δηλαδή το μίγμα που προκύπτει είναι: 0,3% 3-μεθυλοπεντυλοβρωμίδιο-1, 16,9% 3-μεθυλοπεντυλοβρωμίδιο-2, 82,6% 3-μεθυλοπεντυλοβρωμίδιο-3 και 0,1% 2-αιθυλοβουτυλοβρωμίδιο-1.
Ανάλυση του μηχανισμού της χλωρίωσης του CH3CH2CH(CH3)CH2CH3:
1. Έναρξη: Παράγονται ελεύθερες ρίζες.

\mathrm{Cl_2 \xrightarrow[\triangle]{UV} 2Cl^\bullet - 239 kJ}

  • Η απαιτούμενη ενέργεια προέρχεται από το υπεριώδες φως (UV) ή θερμότητα (Δ).
2. Διάδοση: Καταναλώνονται οι παλιές ελεύθερες ρίζες, σχηματίζοντας νέες.

\mathrm{CH_3CH_2CH(CH_3)CH_2CH_3  + Cl^\bullet \xrightarrow{} 0,21CH_3CH_2CH(CH_3)CH_2CH_2^\bullet + 0,52CH_3CH_2CH(CH_3)CH^\bullet CH_3 + 0,17 CH_3CH_2C^\bullet (CH_3)CH_2CH_3 + 0,1 CH_3CH_2CH(CH_2^\bullet )CH_2CH_3 + HCl + 14 kJ}  [27]
\mathrm{CH_3CH_2CH(CH_3)CH_2CH_2^\bullet + Cl_2 \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_2Cl + Cl^\bullet + 100 kJ}
\mathrm{CH_3CH_2CH(CH_3)CH^\bullet CH_3 + Cl_2 \xrightarrow{} CH_3CH_2CH(CH_3)CH(Cl)CH_3 + Cl^\bullet + 100 kJ}
\mathrm{CH_3CH_2C^\bullet (CH_3)CH_2CH_3 + Cl_2 \xrightarrow{} CH_3CH_2C(Cl)(CH_3)CH_2CH_3 + Cl^\bullet + 100 kJ}
\mathrm{CH_3CH_2CH(CH_2^\bullet )CH_2CH_3  + Cl_2 \xrightarrow{} CH_3CH_2CH(CH_2Cl)CH_2CH_3 + Cl^\bullet + 100 kJ}

3. Τερματισμός: Καταναλώνονται μεταξύ τους οι ελεύθερες ρίζες, κατά τη στατιστικά σπάνια περίπτωση της συνάντησής τους.

 \mathrm{2Cl^\bullet \xrightarrow{} Cl_2 + 239 kJ}
 \mathrm{CH_3CH_2CH(CH_3)CH_2CH_2^\bullet + Cl^\bullet \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_2Cl + 339 kJ}
 \mathrm{CH_3CH_2CH(CH_3)CH^\bullet CH_3 + Cl^\bullet \xrightarrow{} (CH_3)_2CHCH_2CH(Cl)CH_3 + 339 kJ}
 \mathrm{CH_3CH_2C^\bullet (CH_3)CH_2CH_3  + Cl^\bullet \xrightarrow{} CH_3CH_2C(Cl)(CH_3)CH_2CH_3  + 339 kJ}
 \mathrm{CH_3CH_2CH(CH_2^\bullet )CH_2CH_3 + Cl^\bullet \xrightarrow{} CH_3CH_2CH(CH_2Cl)CH_2CH_3 + 339 kJ}
 \mathrm{2CH_3CH_2CH(CH_3)CH_2CH_2^\bullet \xrightarrow{} CH_3CH_2CH(CH_3)CH_2CH_2CH_2CH_2CH(CH_3)CH_2CH_3 + 347 kJ}
 \mathrm{2CH_3CH_2CH(CH_3)CH^\bullet CH_3  \xrightarrow{} CH_3CH_2CH(CH_3)CH(CH_3)CH(CH_3)CH(CH_3)CH_2CH_3  + 347 kJ}
 \mathrm{2CH_3CH_2C^\bullet (CH_3)CH_2CH_3 \xrightarrow{} (CH_3CH_2)_2C(CH_3)C(CH_3)(CH_3CH_2)_2 + 347 kJ} [28]
 \mathrm{2CH_3CH_2CH(CH_2^\bullet )CH_2CH_3 \xrightarrow{} CH_3CH_2CH(CH_2CH_3)CH_2CH_2CH(CH_2CH_3)CH_2CH_3 + 347 kJ}

  • Είναι όμως πρακτικά δύσκολο να σταματήσει η αντίδραση στην παραγωγή μονοααλογονιδίων.
  • Αν χρησιμοποιηθούν ισομοριακές ποσότητες CH3CH2CH(CH3)CH2CH3 και Χ2 θα παραχθεί μίγμα όλων των αλογονοπαραγώγων του CH3CH2CH(CH3)CH2CH3.
  • Αν όμως χρησιμοποιηθει περίσσεια CH3CH2CH(CH3)CH2CH3, τότε η απόδοση τωμ μονοπαραγώγων αυξάνεται πολύ, λόγω της αύξησης της στατιστική πιθανότητας συνάντισης CH3CH2CH(CH3)CH2CH3(CH3)2 με X. σε σχέση με την πιθανότητα συνάντισης μονοπαραγώγου και X., που μπορεί να οδηγήσει στην παραγωγή των υπόλοιπων X-παραγώγων.

Παρεμβολή καρβενίων[Επεξεργασία | επεξεργασία κώδικα]

  • Τα καρβένια (π.χ. [:CH2]) μπορούν παρεμβληθούν στους δεσμούς C-H. Π.χ. έχουμε:[29]
  • Η αντίδραση είναι ελάχιστα εκλεκτική και αυτό σημαίνει ότι κατά προσέγγιση έχουμε;

\mathrm{CH_3CH_2CH(CH_3)CH_2CH_3 + CH_3Cl + KOH \xrightarrow{} \frac{3}{7} CH_3CH_2CH(CH_3)CH_2CH_2CH_3 + \frac{2}{7} CH_3CH_2CH(CH_3)CH(CH_3)_2 + \frac{1}{14} CH_3CH_2C(CH_3)_2CH_2CH_3 + \frac{2}{7} CH_3CH_2CH(CH_2CH_3)CH_2CH_3  + KCl + H_2O}

  1. Παρεμβολή στους έξι (6) δεσμούς 1,5-CH2-H: 6
  2. Παρεμβολή στους τέσσρεις (4) δεσμούς 2,4-CH-H: 4.
  3. Παρεμβολή στο δεσμό C-H: 1.
  4. Παρεμβολή στους τρεις (3) δεσμούς 1'-CH2-H): 4.

Προκύπτει επομένως μίγμα 3-μεθυλοεξάνιου (~43%), 2,3-διμεθυλοπεντάνιου (~29%), 3,3-διμεθυλοπεντάνιο (~7%) και αιθυλοπεντάνιου (-29%).

Νίτρωση[Επεξεργασία | επεξεργασία κώδικα]

  • Αντιδρά με ατμούς HNO3 στην αέρια φάση:[30]

\mathrm{CH_3CH_2CH(CH_3)CH_2CH_3 + HNO_3 \xrightarrow{\triangle} aCH_3CH_2CH(CH_3)CH_2CH_2NO_2 + bCH_3CH_2CH(CH_3)CH(NO_2)CH_3 + cCH_3CH_2C(NO_2)(CH_3)CH_2CH_3 + dCH_3CH_2CH(CH_2NO_2)CH_2CH_3 + H_2O}

όπου 0<a,b,c,d<1, a + b + c + d = 1.

Προσθήκη σε πολλαπλούς δεσμούς[Επεξεργασία | επεξεργασία κώδικα]

Το 3-μεθυλοπεντάνιο μπορεί να δώσει αντιδράσεις προσθήκης σε πολλαπλούς δεσμούς κατά την έννοια (CH3CH2)2Cδ-(CH3)-Hδ+. Π.χ.:[31]

\mathrm{(CH_3CH_2)_2CHCH_3 + RCH=CH_2  \xrightarrow[0^oC]{HF} (CH_3CH_2)_2C(CH_3)CH(R)CH_3}

Καταλυτική ισομερείωση[Επεξεργασία | επεξεργασία κώδικα]

To 2-μεθυλοπεντάνιο μπορεί να υποστεί καταλυτική ισομερείωση προς εξάνιο, 2-μεθυλοπεντάνιο, νεοεξάνιο και 2,3-διμεθυλοβουτάνιο:

 \mathrm{CH_3CH_2CH_2CH_2CH_2CH_3 \stackrel{AlCl_3}{\overrightarrow\longleftarrow} CH_3CH_2CH_2CH(CH_3)_2  \stackrel{AlCl_3}{\overrightarrow\longleftarrow} CH_3CH_2CH(CH_3)CH_2CH_3 \stackrel{AlCl_3}{\overrightarrow\longleftarrow} (CH_3)_4C \stackrel{AlCl_3}{\overrightarrow\longleftarrow} CH_3CH(CH_3)CH(CH_3)CH_2CH_3}

Aναφορές και σημειώσεις[Επεξεργασία | επεξεργασία κώδικα]

  1. Άτομο C ενωμένο με ένα (1) άλλο άτομο C.
  2. Άτομο C ενωμένο με δύο (2) άλλα άτομα C.
  3. Άτομο C ενωμένο με τρία (3) άλλα άτομα C.
  4. Τα δεδομένα προέρχονται εν μέρει από το «Table of periodic properties of thw Ellements», Sagrent-Welch Scientidic Company και Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, Σελ. 34.
  5. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 187, §7.3.5
  6. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.2.2β, R = CH3CH2, R' = CH3CH2CH2CHCH3
  7. [1]:Google Βιβλία:Chemical properties handbook: physical, thermodynamic, environmental ... Από τον Carl L. Yaws
  8. Συνηθισμένες συνθήκες: P = 1 atm, Τ = 25 °C.
  9. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.2.1β., με R = CH3CH2CH(CH3)CH2CH2 ή CH3CH2CH2CH(CH3)CHCH3 ή CH3CH2C(CH3)CH2CH3 ή (CH3CH2)2CΗCH2
  10. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, §6.2.1α., με R = CH3CH2CH(CH3)CH2CH2 ή CH3CH2CH2CH(CH3)CHCH3 ή CH3CH2C(CH3)CH2CH3 ή (CH3CH2)2CΗCH2
  11. Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991, σελ.14, §1.1
  12. Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991, σελ. 291-293, §19.1.
  13. SCHAUM'S OUTLINE SERIES, ΟΡΓΑΝΙΚΗ ΧΗΜΕΙΑ, Μτφ. Α. Βάρβογλη, 1999, Σελ. 42, §4.3.
  14. Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991, σελ.80-82, §5.1-5.2
  15. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.2.4α., με R = CH3CH2CH(CH3)CH2CH2 ή CH3CH2CH2CH(CH3)CHCH3 ή CH3CH2C(CH3)CH2CH3 ή (CH3CH2)2CΗCH2
  16. 16,0 16,1 16,2 16,3 16,4 16,5 16,6 16,7 16,8 16,9 Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.2.5.
  17. 17,0 17,1 17,2 17,3 17,4 Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 158, §6.9.4α.
  18. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.7.6β.
  19. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.7.6α, R = CH3, R' = CH3CH2CH2CH(CH3)2
  20. 20,0 20,1 Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ.269, §11.6B7.
  21. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.2.3α., με R = CH3CH(CH3)CH2CH2 ή CH3CH2CH(CH3)CHCH3 ή CH3CH2C(CH3)CH2CH3 ή (CH3CH2)2CHCH3
  22. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 155, §6.7.1, v = 6 και μετατροπή μονάδας ενέργειας σε kJ.
  23. ΔHC-C= +347 kJ/mol
  24. ΔHC-H = +415 kJ/mol
  25. ΔHO-O=+146 kJ/mol
  26. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.7.1β., με R = CH3CH2CH(CH3)CH2CH2 ή CH3CH2CH2CH(CH3)CHCH3 ή CH3CH2C(CH3)CH2CH3 ή (CH3CH2)2CHCH2
  27. καθοριστικό ταχύτητας}
  28. Δεν πραγματοποιείται λόγω στερεοχημικής παρεμπόδισης.
  29. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 155, §6.7.3, R = CH3CH2CH(CH3)CH2CH2 ή CH3CH2CH2CH(CH3)CHCH3 ή CH3CH2C(CH3)CH2CH3 ή (CH3CH2)2CHCH2.
  30. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 244 , §10.3.2, R = CH3CH2CH(CH3)CH2CH2 ή CH3CH2CH2CH(CH3)CHCH3 ή CH3CH2C(CH3)CH2CH3 ή (CH3CH2)2CHCH2.
  31. SCHAUM'S OUTLINE SERIES, ΟΡΓΑΝΙΚΗ ΧΗΜΕΙΑ, Μτφ. Α. Βάρβογλη, 1999, σελ. 85, §6.3.

Πηγές[Επεξεργασία | επεξεργασία κώδικα]

  • Η σελίδα της Ε.Ε. για την ταξινόμηση και την επισήμανση των επικίνδυνων ουσιών.
  • Παπαγεωργίου Β.Π., “Εφαρμοσμένη Οργανική Χημεία: Άκυκλες Ενώσεις”, Εκδόσεις Παρατηρητής, Θεσσαλονίκη 1986.
  • Γ. Βάρβογλη, Ν. Αλεξάνδρου, Οργανική Χημεία, Αθήνα 1972
  • Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991
  • SCHAUM'S OUTLINE SERIES, ΟΡΓΑΝΙΚΗ ΧΗΜΕΙΑ, Μτφ. Α. Βάρβογλη, 1999
  • Μερικές από τις ενέργειες αντιδράσεων υπολογίστηκαν με χρήση κατάλληλου λογισμικού. Θα διασταυρωθούν και βιβλιογραφικά το συντομότερο για μεγαλύτερη ακρίβεια.
Στο λήμμα αυτό έχει ενσωματωθεί κείμενο από το λήμμα 3-Methylpentane της Αγγλικής Βικιπαίδειας, η οποία διανέμεται υπό την GNU FDL και την CC-BY-SA 3.0. (ιστορικό/συντάκτες).