2-μεθυλεπτάνιο

Από τη Βικιπαίδεια, την ελεύθερη εγκυκλοπαίδεια
Μετάβαση σε: πλοήγηση, αναζήτηση
2-μεθυλεπτάνιο
2-Methylheptane.png
2-methyl-heptane-spaceFill.png
Γενικά
Όνομα IUPAC 2-μεθυλεπτάνιο
Χημικά αναγνωριστικά
Χημικός τύπος C8H18
Μοριακή μάζα 114,23 amu
Σύντομος
συντακτικός τύπος
(CΗ3)2CH(CH2)43
Συντομογραφίες iBuBu
Αριθμός CAS 592-27-8
SMILES CC(C)CCCCC
InChI 1S/C8H18/c1-4-5-6-7-8(2)3/h8H,4-7H2,1-3H3
Αριθμός EINECS 209-747-9
PubChem CID 11594
ChemSpider ID 11106
Ισομέρεια
Ισομερή θέσης 17
Φυσικές ιδιότητες
Σημείο τήξης −108,9 °C
Σημείο βρασμού 116 °C
Πυκνότητα 698 kg/m3
Τάση ατμών 5,3 kPa (38 °C)
Εμφάνιση Άχρωμο υγρό
Χημικές ιδιότητες
Ελάχιστη θερμοκρασία
ανάφλεξης
4,4 °C
Επικινδυνότητα
Hazard F.svg Hazard X.svg Hazard N.svg
Εξαιρετικά εύφλεκτο (F+), Επιβλαβές (Xn), Τοξικό για τους υδρόβιους οργανισμούς (N)
Φράσεις κινδύνου R11, R38, R50/53, R65, R67
Φράσεις ασφαλείας S9, S16, S29, S33, S60, S61, S62
Κίνδυνοι κατά
NFPA 704
NFPA 704.svg
3
0
0
Η κατάσταση αναφοράς είναι η πρότυπη κατάσταση (25°C, 1 Atm)
εκτός αν σημειώνεται διαφορετικά

Το 2-μεθυλεπτάνιο είναι ένα διακλαδισμένο αλκάνιο, δηλαδή άκυκλος κορεσμένος υδρογονάνθρακας, με χημικό τύπο C8H18 και σύντομο συντακτικό τύπο (CΗ3)2CH(CH2)43.

Ισομέρεια[Επεξεργασία | επεξεργασία κώδικα]

Το 2-μεθυλεπτάνιο έχει τα ακόλουθα δεκαεπτά (17) ισομερή θέσης:

  1. οκτάνιο, με σύντομο συντακτικό τύπο CH3(CH2)6CH3).
  2. 3-μεθυλεπτάνιο, με σύντομο συντακτικό τύπο CH3(CH2)3CH(CH3)CH2CH3 (σε δύο (2) οπτικά ισομερή).
  3. 4-μεθυλεπτάνιο, με σύντομο συντακτικό τύπο [CH3(CH2)2]2CHCH3.
  4. Αιθυλεξάνιο, με σύντομο συντακτικό τύπο (CH3CH2)2CHCH2CH2CH3.
  5. 2,2-διμεθυλεξάνιο ή νεοοκτάνιο, με σύντομο συντακτικό τύπο (CH3)3C(CH2)3CH3.
  6. 2,3-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο (CH3)2CΗCH(CH3)CH2CH2CH3 (σε δύο (2) οπτικά ισομερή).
  7. 2,4-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο (CH3)2CΗCH2CH(CH3)CH2CH3 (σε δύο (2) οπτικά ισομερή).
  8. 2,5-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο (CH3)2CΗCH2CH2CΗ(CH3)2
  9. 3,3-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο CH3CH2C(CH3)2CH2CH2CH3.
  10. 3,4-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο CH3CH2CH(CH3)CH(CH3)CH2CH3 (σε τρία (3) οπτικά ισομερή).
  11. Αιθυλο-2-μεθυλοπεντάνιο, με σύντομο συντακτικό τύπο (CH3CH2)2CHCH(CH3)2.
  12. Αιθυλο-3-μεθυλοπεντάνιο, με σύντομο συντακτικό τύπο (CH3CH2)2C(CH3)2.
  13. 2,2,3-τριμεθυλοπεντάνιο, με σύντομο συντακτικό τύπο CH3CH2CH(CH3)C(CH3)3 (σε δύο (2) οπτικά ισομερή).
  14. 2,2,4-τριμεθυλοπεντάνιο ή ισοκτάνιο, με σύντομο συντακτικό τύπο (CH3)2CHCH2C(CH3)3 (σε δύο (2) οπτικά ισομερή).
  15. 2,3,3-τριμεθυλοπεντάνιο, με σύντομο συντακτικό τύπο CH3CH2C(CH3)2CH(CH3)2.
  16. 2,3,4-τριμεθυλοπεντάνιο, με σύντομο συντακτικό τύπο (CH3)2CHCH(CH3)CH(CH3)2 (σε δύο (2) οπτικά ισομερή).
  17. Tετραμεθυλοβουτάνιο (CH3)3CC(CH3)3.

Ονοματολογία[Επεξεργασία | επεξεργασία κώδικα]

Η ονομασία «2-μεθυλεπτάνιο» από την ονοματολογία κατά IUPAC. Συγκεκριμένα, το αρχικό πρόθεμα «μεθυλ-» δηλώνει την παρουσία διακλάδωσης ενός (1) ατόμου άνθρακα και συγκεκριμένα στο άτομο άνθρακα #2, όπως δηλώνει ο αρχικός αριθμός θέσης, το τμήμα «επτ-» δηλώνει την παρουσία επτά (7) ατόμων άνθρακα στην κύρια ανθρακική αλυσίδα της ένωσης, το ενδιάμεσο «-αν-» δείχνει την παρουσία μόνο απλών δεσμών μεταξύ ατόμων άνθρακα στο μόριο και η κατάληξη «-ιο» φανερώνει ότι δεν περιέχει χαρακτηριστικές ομάδες, δηλαδή ότι είναι υδρογονάνθρακας.

Δομή[Επεξεργασία | επεξεργασία κώδικα]

Το μόριό του αποτελείται από οκτώ (8) άτομα άνθρακα (τρία (3) πρωτοταγή[1], τέσσερα (4) δευτεροταγή[2] και ένα (1) τριτοταγές[3]) και δεκαοκτώ (18) άτομα υδρογόνου.

Δεσμοί[4]
Δεσμός τύπος δεσμού ηλεκτρονική δομή Μήκος δεσμού Ιονισμός
C-H σ 2sp3-1s 109 pm 3% C- H+
C-C σ 2sp3-2sp3 154 pm
Κατανομή φορτίων
σε ουδέτερο μόριο
C#1,#7,#1' -0,09
C#3-#6 -0,06
C#2 -0,03
H +0,03

Παραγωγή[Επεξεργασία | επεξεργασία κώδικα]

Απομόνωση από φυσικές και βιομηχανικές πηγές[Επεξεργασία | επεξεργασία κώδικα]

  1. Απομονώνεται από το πετρέλαιο.
  2. Απομονώνεται από μίγματα που προκύπτουν από πυρόλυση βαρύτερων προϊόντων διύλισης πετρελαίου ή πολυμερών υδρογονανθράκων.

Παραγωγή με αντιδράσεις σύνθεσης: Από πρώτες ύλες με μικρότερη ανθρακική αλυσίδα[Επεξεργασία | επεξεργασία κώδικα]

Δομικά το 2-μεθυλεπτάνιο αποτελείται από δυο μέρη: ισοβουτύλιο [(CH3)2CHCH2-] και βουτύλιο (CH3CH2CH2CH2). Επομένως, ο απλούστερος τρόπος παρασκευής καθαρού 2-μεθυλεπτάνιου είναι η αντίδραση ζεύγους 1-αλομεθυλοπροπάνιου - βουτυλολιθίου ή ισοβουτυλολιθίου - 1-αλοβουτανίου:

\mathrm{CH_3CH_2CH_2CH_2X + 2Li \xrightarrow{|Et_2O|} CH_3CH_2CH_2CH_2Li + LiX}
\mathrm{(CH_3)_2CHCH_2X + CH_3CH_2CH_2CH_2Li \xrightarrow{} CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2 + LiX}
ή
\mathrm{(CH_3)_2CHCH_2X + 2Li \xrightarrow{|Et_2O|} (CH_3)_2CHCH_2Li + LiX}
\mathrm{(CH_3)_2CHCH_2Li + CH_3CH_2CH_2CH_2X \xrightarrow{} CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2 + LiX}

Παραγωγή με αντιδράσεις χωρίς αλλαγή ανθρακικής αλυσίδας[Επεξεργασία | επεξεργασία κώδικα]

Με αναγωγή αλογονούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

Με αναγωγή κατάλληλων αλογονούχων ενώαεων μπορεί να παραχθεί 2-μεθυλεπτάνιο. Π.χ. για την αναγωγή του 1-αλο-2-μεθυλεπτανίου υπάρχουν οι ακόλουθες μέθοδοι:[5]

1. Με «υδρογόνο εν τω γεννάσθαι», δηλαδή μέταλλο + οξύ:

 \mathrm{CH_3CH_2CH_2CH_2CH_2CH(CH_3)CH_2X  + Zn + HX \xrightarrow{} CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2 + ZnX_2}

2. Με λιθιοαργιλιοϋδρίδιο (LiAlH4) ή νατριοβοριοϋδρίδιο (NaBH4):[6]

 \mathrm{4CH_3CH_2CH_2CH_2CH_2CH(CH_3)CH_2X + LiAlH_4 \xrightarrow{} 4CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2 + AlX_3 + LiX}

3. Με αναγωγή των αντίστοιχων αλκυλιωδιδίων από HI:[7]

 \mathrm{2CH_3CH_2CH_2CH_2CH_2CH(CH_3)CH_2I  + HI \xrightarrow{} 2CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2 + I_2}

4. Με αναγωγή από μέταλλα (συνήθως λίθιο ή μαγνήσιο) και στη συνέχεια υδρόλυση των παραγόμενων οργανομεταλλικών ενώσεων:[8]

 \mathrm{CH_3CH_2CH_2CH_2CH_2CH(CH_3)CH_2X + 2Li \xrightarrow[-LiX]{|Et_2O|} CH_3CH_2CH_2CH_2CH_2CH(CH_3)CH_2Li \xrightarrow{+H_2O} CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2 + LiOH}
ή
 \mathrm{CH_3CH_2CH_2CH_2CH_2CH(CH_3)CH_2X + Mg \xrightarrow{|Et_2O|} CH_3CH_2CH_2CH_2CH_2CH(CH_3)CH_2MgX \xrightarrow{+H_2O} CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2 + Mg(OH)X \downarrow}

5. Με αναγωγή από σιλάνιο, παρουσία τριφθοριούχου βορίου, παράγεται 2-μεθυλεπτάνιο.Π.χ.::[9]


\mathrm{CH_3CH_2CH_2CH_2CH_2CH(CH_3)CH_2X + SiH_4 \xrightarrow{BF_3} CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2 + SiH_3X}

Με αναγωγή οξυγονούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

Με αναγωγή κατάλληλων αλδεϋδών μπορεί να παραχθεί 2-μεθυλεπτάνιο. Π.χ. από την αναγωγή της 2-μεθυλοεπτανάλης με υδραζίνη (NH2NH2) (Αντίδραση Wölf-Kishner):[10]

\mathrm{CH_3CH_2CH_2CH_2CH_2CH(CH_3)CHO + NH_2NH_2 \xrightarrow{KOH} CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2 \uparrow + N_2 \uparrow + H_2O}

2. Με αναγωγή των κατάλληλων κετονών μπορεί να παραχθεί 2-μεθυλεπτάνιο. Π.χ. από την αναγωγή της 2-μεθυλοεπτανόνης-3 (Αντίδραση Clemmensen):[11]

\mathrm{CH_3CH_2CH_2CH_2COCH(CH_3)_2 + 2Zn + 2HCl \xrightarrow{} CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2  + ZnCl_2 + ZnO}

Με αναγωγή θειούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

1. Με αναγωγή των κατάλληλων θειολών μπορεί να παραχθεί 2-μεθυλεπτάνιο. Π.χ. από την αναγωγή της 2-μεθυλεπτανοθειόλης-1 (μέθοδος Raney):[12]

\mathrm{CH_3CH_2CH_2CH_2CH_2CH(CH_3)CH_2SH + H_2 \xrightarrow{Ni} CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2  + H_2S}

2. Με αναγωγή των κατάλληλων θειεστέρων μπορεί να παραχθεί 2-μεθυλεπτάνιο. Π.χ. από την αναγωγή του 1-(2΄-μεθυλεπτυλοθειο)-2-μεθυλεπτάνιου(μέθοδος Raney):[12]

\mathrm{CH_3CH_2CH_2CH_2CH_2CH(CH_3)CH_2SCH_2CH(CH_3)CH_2CH_2CH_2CH_2CH_3 + H_2 \xrightarrow{Ni} 2CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2  + H_2S}


Με καταλυτική υδρογόνωση ακόρεστων αλειφατικών υδρογονανθράκων[Επεξεργασία | επεξεργασία κώδικα]

Με καταλυτική υδρογόνωση κατάλληλων ακόρεστων αλειφατικών υδρογονανθράκων μπορεί να παραχθεί 2-μεθυλεπτάνιο. Π.χ. με καταλυτική υδρογόνωση του 2-μεθυλεπτένιου-1:

\mathrm{CH_3CH_2CH_2CH_2CH_2C(CH_3)=CH_2 + H_2 \xrightarrow{Ni,\;Pd,\;Pt} CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2}

Παρασκευή με αντιδράσεις αποσύνθεσης με μείωση του μήκους της ανθρακικής αλυσίδας[Επεξεργασία | επεξεργασία κώδικα]

  • Mε τη θέρμανση αΛκαλικού διαλύματος των κατάλληλων καρβοξυλικών οξέων παράγεται 2-μεθυλεπτάνιο.

Π.χ. κατάλληλο είναι το 3-μεθυλοκτανικό οξύ:

\mathrm{CH_3CH_2CH_2CH_2CH_2CH(CH_3)CH_2COOH + NaOH \xrightarrow{} CH_3CH_2CH_2CH_2CH_2CH(CH_3)CH_2COONa + H_2O \xrightarrow{\triangle} CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2 + NaHCO_3 }

Χημικές ιδιότητες[Επεξεργασία | επεξεργασία κώδικα]

Η διακλάδωση κάνει το 2-μεθυλεπτάνιο πιο εύφλεκτο από το οκτάνιο, όπως φαίνεται από τη χαμηλότερη θερμοκρασία αυτοανάφλεξης και την ελάχιστη θερμοκρασία ανάφλεξης σε σχέση με το οκτάνιο. Επίσης, θεωρητικά το 2-μεθυλεπτάνιο καίγεται με φλογα που παράγει λιγότερη αιθάλη και εκπέμπει ακτινοβολία υψηλότερης συχνότητας, αλλά επειδή η διαφορά είναι μικρή, το αποτέλεσμα και για τα δυο ισομερή είναι μια έντονη κίτρινη φλόγα όταν αναφλέγονται.

Επίσης, σε σύγκριση με το επτάνιο, το 2-μεθυλεπτάνιο έχει χαμηλότερο σημείο τήξης, χαμηλότερο σημείο βρασμού αλλά και χαμηλότερη πυκνότητα.

Στην κλίμακα NFPA 704 το 2-μεθυλεπτάνιο κατατάσσεται στο επίπεδο 0 χημικής δραστικότητας, μαζί με τα υπόλοιπα άλλα αλκάνια. Ωστόσο η παρουσία του τριτοταγούς #2 ατόμου άνθρακα διευκολύνει την οξείδωσή του και τις φωτοχημικές αντιδράσεις με αλογόνα, συνήθως με το βρώμιο, σε διαλύτες όπως συνήθως το 1,1,1-τριχλωραιθάνιο.

Οξείδωση[Επεξεργασία | επεξεργασία κώδικα]

1. Όπως όλα τα αλκάνια, το 2-μεθυλεπτάνιο με περίσσεια οξυγόνου καίγεται προς διοξείδιο του άνθρακα και νερό:[13]

\mathrm{2C_8H_{18} + 25O_2 \xrightarrow{\triangle} 16CO_2 + 18H_2O + 10971 J}

  • Αν και η αντίδραση είναι μια έντονα εξώθερμη δεν συμβαίνει σε μέτριες θερμοκρασίες, γιατί για την έναρξή της πρέπει να υπερπηδηθεί πρώτα το εμπόδιο της διάσπασης των δεσμών C-C,[14] των δεσμών C-H[15] και των δεσμών (Ο=Ο)[16] του O2:

2. Παραγωγή υδραερίου:

\mathrm{C_8H_{18} + 8H_2O \xrightarrow[700-1100^oC]{Ni} 8CO + 17H_2}

3. Καταλυτική οξείδωση κυρίως προς 2-μεθυλεπτανόλη-2:

\mathrm{CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2 + \frac{1}{2}O_2 \xrightarrow[\triangle]{Cu} CH_3CH_2CH_2CH_2CH_2C(OH)(CH_3)_2}

4. Οξείδωση με υπερμαγγανικό κάλιο προς 2-μεθυλεπτανόλη-2:

\mathrm{3CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2 + 2KMnO_4 + H_2SO_4 \xrightarrow{} CH_3CH_2CH_2CH_2CH_2C(OH)(CH_3)_2 + 2MnO_2 + K_2SO_4 + H_2O}

Αλογόνωση [17][Επεξεργασία | επεξεργασία κώδικα]

 \mathrm{CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2  + X_2 \xrightarrow[\triangle]{UV} aCH_3CH_2CH_2CH_2CH_2CH(CH_3)CH_2X + bCH_3CH_2CH_2CH_2CH_2CX(CH_3)_2 + cCH_3CH_2CH_2CH_2CHXCH(CH_3)_2 + dCH_3CH_2CH_2CHXCH_2CH(CH_3)_2 +
eCH_3CH_2CHXCH_2CH_2CH(CH_3)_2 + fCH_3CHXCH_2CH_2CH_2CH(CH_3)_2 + gXCH_2CH_2CH_2CH_2CH_2CH(CH_3)_2 + HX}

  • Δραστικότητα των X2: F2 > Cl2 > Br2 > Ι2.
  • όπου 0<a,b,c,d,e,f,g<1, a + b + c + d + e + f + g = 0, διαφέρουν ανάλογα με το αλογόνο:
  • Τα F και Cl είναι πιο δραστικά και λιγότερο εκλεκτικά. Η αναλογία των προπυλαλογονιδίων τους εξαρτάται κυρίως πό τη στατιστική αναλογία των προς αντικατάσταση ατόμων H.
  • Ειδικά για το χλώριο θα έχουμε:
  1. Υποκατάσταση σε ένα από τα έξι (6) συνολικά άτομα υδρογόνου των ατόμων άνθρακα #1 και #1΄. Παράγεται 2-μεθυλο-1-χλωρεπτάνιο: 6·1 = 6.
  2. Υποκατάσταση στο άτομο υδρογόνου του ατόμου άνθρακα #2. Παράγεται 2-μεθυλο-2-χλωρεπτάνιο: 1·5 = 5.
  3. Υποκατάσταση σε ένα από τα δύο (2) άτομα υδρογόνου του ατόμου άνθρακα #3. Παράγεται 2-μεθυλο-3-χλωρεπτάνιο: 2·3,8 = 7,6.
  4. Υποκατάσταση σε ένα από τα δύο (2) άτομα υδρογόνου του ατόμου άνθρακα #4. Παράγεται 2-μεθυλο-4-χλωρεπτάνιο: 2·3,8 = 7,6.
  5. Υποκατάσταση σε ένα από τα δύο (2) άτομα υδρογόνου του ατόμου άνθρακα #5. Παράγεται 6-μεθυλο-3-χλωρεπτάνιο: 2·3,8 = 7,6.
  6. Υποκατάσταση σε ένα από τα δύο (2) άτομα υδρογόνου του ατόμου άνθρακα #5. Παράγεται 6-μεθυλο-2-χλωρεπτάνιο: 2·3,8 = 7,6.
  7. Υποκατάσταση σε ένα από τα τρία (3) άτομα υδρογόνου του ατόμου άνθρακα #7. Παράγεται 6-μεθυλο-1-χλωρεπτάνιο: 3·1 = 3.
  • Δηλαδή το μίγμα που προκύπτει είναι: 13,5% 2-μεθυλο-1-χλωρεπτάνιο, 11,3% 2-μεθυλο-2-χλωρεπτάνιο, 17,1% 2-μεθυλο-3-χλωρεπτάνιο

17,1%, 2-μεθυλο-4-χλωρεπτάνιο, 17,1% 6-μεθυλο-3-χλωρεπτάνιο, 17,1% 6-μεθυλο-2-χλωρεπτάνιο και 6,8% 6-μεθυλο-1-χλωρεπτάνιο.

  • Τα Br και I είναι πιο εκλεκτικά και λιγότερο δραστικά. Η αναλογία των πεντυλαλογονιδίων μεταβάλλεται προς όφελος του τριτοταγούς (αυτού που το αλογόνο συνδέεται με τριτοταγές άτομο C, δηλαδή ατόμου C ενωμένου με 3 άλλα άτομα C) 2-μεθυλοβουτυλοαλογονιδίου-2.
  • Ειδικα για το βρώμιο θα έχουμε:
  1. Υποκατάσταση σε ένα από τα έξι (6) συνολικά άτομα υδρογόνου των ατόμων άνθρακα #1 και #1΄. Παράγεται 1-βρωμο-2-μεθυλεπτάνιο: 6·1 = 6.
  2. Υποκατάσταση στο άτομο υδρογόνου του ατόμου άνθρακα #2. Παράγεται 2-βρωμο-2-μεθυλεπτάνιο: 1·1600 = 1600.
  3. Υποκατάσταση σε ένα από τα δύο (2) άτομα υδρογόνου του ατόμου άνθρακα #3. Παράγεται 3-βρωμο-2-μεθυλεπτάνιο: 2·82 = 164.
  4. Υποκατάσταση σε ένα από τα δύο (2) άτομα υδρογόνου του ατόμου άνθρακα #4. Παράγεται 4-βρωμο-2-μεθυλεπτάνιο: 2·82 = 164.
  5. Υποκατάσταση σε ένα από τα δύο (2) άτομα υδρογόνου του ατόμου άνθρακα #5. Παράγεται 3-βρωμο-6-μεθυλεπτάνιο: 2·82 = 164.
  6. Υποκατάσταση σε ένα από τα δύο (2) άτομα υδρογόνου του ατόμου άνθρακα #6. Παράγεται 2-βρωμο-6-μεθυλεπτάνιο: 2·82 = 164.
  7. Υποκατάσταση σε ένα από τα τρία (3) άτομα υδρογόνου του ατόμου άνθρακα #7. Παράγεται 1-βρωμο-6-μεθυλεπτάνιο: 3·1 = 3.
  • Δηλαδή το μίγμα που προκύπτει είναι: 0,3% 1-βρωμο-2-μεθυλεπτάνιο, 70,6% 2-βρωμο-2-μεθυλεπτάνιο, 7,2% 3-βρωμο-2-μεθυλεπτάνιο, 7,2% 4-βρωμο-2-μεθυλεπτάνιο, 7,2% 3-βρωμο-6-μεθυλεπτάνιο, 7,2% 2-βρωμο-6-μεθυλεπτάνιο και 0,1% 1-βρωμο-6-μεθυλεπτάνιο.
  • Είναι όμως πρακτικά δύσκολο να σταματήσει η αντίδραση στην παραγωγή μονοααλογονιδίων.
  • Αν χρησιμοποιηθούν ισομοριακές ποσότητες CH3CH2CH2CH2CH2CH(CH3)2 και Χ2 θα παραχθεί μίγμα όλων των αλογονοπαραγώγων του CH3CH2CH2CH2CH(CH3)2.
  • Αν όμως χρησιμοποιηθει περίσσεια CH3CH2CH2CH2CH2CH(CH3)2, τότε η απόδοση τωμ μονοπαραγώγων αυξάνεται πολύ, λόγω της αύξησης της στατιστική πιθανότητας συνάντισης CH3CH2CH2CH2CH2CH(CH3)2 με X. σε σχέση με την πιθανότητα συνάντισης μονοπαραγώγου και X., που μπορεί να οδηγήσει στην παραγωγή των υπόλοιπων X-παραγώγων.

Νίτρωση[Επεξεργασία | επεξεργασία κώδικα]

  • Αντιδρά με ατμούς HNO3 στην αέρια φάση:[18]

 \mathrm{CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2  + HNO_3 \xrightarrow{\triangle} aCH_3CH_2CH_2CH_2CH_2CH(CH_3)CH_2NO_2 + bCH_3CH_2CH_2CH_2CH_2C(NO_2)(CH_3)_2 + cCH_3CH_2CH_2CH_2CH(NO_2)CH(CH_3)_2 + dCH_3CH_2CH_2CH(NO_2)CH_2CH(CH_3)_2 + eCH_3CH_2CH(NO_2)CH_2CH_2CH(CH_3)_2 + CH_3CH(NO_2)CH_2CH_2CH_2CH(CH_3)_2 + gO_2NCH_2CH_2CH_2CH(CH_3)_2 + H_2O}

όπου 0<a,b,c,d,e,f,g<1, a + b + c + d + e + f + g = 1.

Παρεμβολή καρβενίων[Επεξεργασία | επεξεργασία κώδικα]

  • Τα καρβένια (π.χ. [:CH2]) μπορούν παρεμβληθούν στους δεσμούς C-H. Π.χ. έχουμε:[19]

\mathrm{CH_3CH_2CH_2CH_2CH_2CH(CH_3)_2 + CH_3Cl + KOH \xrightarrow{} \frac{1}{3} CH_3CH_2CH_2CH_2CH_2CH(CH_3)CH_2CH_3 + \frac{1}{18} CH_3CH_2CH_2CH_2CH_2C(CH_3)_3 + \frac{1}{9} CH_3CH_2CH_2CH_2CH(CH_3)CH(CH_3)_2 + \frac{1}{9} CH_3CH_2CH_2CH(CH_3)CH_2CH(CH_3)_2 + \frac{1}{9} CH_3CH_2CH(CH_3)CH_2CH_2CH(CH_3)_2 + \frac{1}{9} (CH_3)_2CHCH_2CH(CH_3)_2 + \frac{1}{6} CH_3CH_2CH_2CH_2CH_2CH_2CH(CH_3)_2 + KCl + H_2O}

  • Η αντίδραση είναι ελάχιστα εκλεκτική και αυτό σημαίνει ότι κατά προσέγγιση έχουμε;
  1. Παρεμβολή στους έξι (6) δεσμούς C#1,#1΄H2-H. Παράγεται 3-μεθυλοκτάνιο.
  2. Παρεμβολή στο δεσμό C#2-H. Παράγεται 2,2-διμεθυλεπτάνιο.
  3. Παρεμβολή στους δύο (2) δεσμούς C#3H-H: 2. Παράγεται 2,3-διμεθυλεπτάνιο.
  4. Παρεμβολή στους δύο (2) δεσμούς C#4H-H: 2. Παράγεται 2,4-διμεθυλεπτάνιο.
  5. Παρεμβολή στους δύο (2) δεσμούς C#5H-H: 2. Παράγεται 2,5-διμεθυλεπτάνιο.
  6. Παρεμβολή στους δύο (2) δεσμούς C#6H-H: 2. Παράγεται 2,6-διμεθυλεπτάνιο.
  7. Παρεμβολή στους τρεις (3) δεσμούς C#7H2-H. Παράγεται 2-μεθυλοκτάνιο.

Προκύπτει επομένως μίγμα 3-μεθυλοκτάνιου (~33%), 2,2-διμεθυλεπτάνιου (~5%), 2,3-διμεθυλεπτάνιο (~11%), 2,4-διμεθυλεπτάνιου (~11%), 2,5-διμεθυλεπτάνιου (~11%), 2,6-διμεθυλεπτάνιου (~11%) και 2-μεθυλοκτάνιου (-17%).

Καταλυτική ισομερείωση[Επεξεργασία | επεξεργασία κώδικα]

To 2-μεθυλεπτάνιο μπορεί να υποστεί καταλυτική ισομερείωση προς τα ισομερή του.

Aναφορές και σημειώσεις[Επεξεργασία | επεξεργασία κώδικα]

  1. Άτομο C ενωμένο με ένα (1) άλλο άτομο C.
  2. Άτομο C ενωμένο με δύο (2) άλλα άτομα C.
  3. άτομο C ενωμένο με τρία (3) άλλα άτομα C.
  4. Τα δεδομένα προέρχονται εν μέρει από το «Table of periodic properties of thw Ellements», Sagrent-Welch Scientidic Company και Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, Σελ. 34.
  5. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.2.1β
  6. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, §6.2.1α
  7. Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991, σελ.14, §1.1
  8. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.2.4α.Π.χ.:
  9. Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991, σελ. 291-293, §19.1.
  10. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.7.6β.
  11. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.7.6α
  12. 12,0 12,1 Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ.269, §11.6B7.
  13. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 155, §6.7.1, v = 8 και μετατροπή μονάδας ενέργειας σε kJ.
  14. ΔHC-C= +347 kJ/mol
  15. ΔHC-H = +415 kJ/mol
  16. ΔHO-O=+146 kJ/mol
  17. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.7.1β.
  18. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 244 , §10.3.2.
  19. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 155, §6.7.3, R = CH3CH(CH3)CHCH3 ή CH3CH2C(CH3)2 ή CH3CH(CH3)CHCH3 ή CH3CH(CH3)CH2CH2.

Πηγές[Επεξεργασία | επεξεργασία κώδικα]

  • Παπαγεωργίου Β.Π., “Εφαρμοσμένη Οργανική Χημεία: Άκυκλες Ενώσεις”, Εκδόσεις Παρατηρητής, Θεσσαλονίκη 1986.
  • Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982
  • Γ. Βάρβογλη, Ν. Αλεξάνδρου, Οργανική Χημεία, Αθήνα 1972
  • Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991
  • SCHAUM'S OUTLINE SERIES, ΟΡΓΑΝΙΚΗ ΧΗΜΕΙΑ, Μτφ. Α. Βάρβογλη, 1999
  • Μερικές από τις ενέργειες αντιδράσεων υπολογίστηκαν με χρήση κατάλληλου λογισμικού. Θα διασταυρωθούν και βιβλιογραφικά το συντομότερο για μεγαλύτερη ακρίβεια.
Στο λήμμα αυτό έχει ενσωματωθεί κείμενο από το λήμμα 2-Methylheptane της Αγγλικής Βικιπαίδειας, η οποία διανέμεται υπό την GNU FDL και την CC-BY-SA 3.0. (ιστορικό/συντάκτες).