2,3-διμεθυλεξάνιο

Από τη Βικιπαίδεια, την ελεύθερη εγκυκλοπαίδεια
Μετάβαση σε: πλοήγηση, αναζήτηση
2,3-διμεθυλεξάνιο
2,3-dimethylhexane.png
2,3-Dimethylhexane-3D-balls.png
Γενικά
Όνομα IUPAC 2,3-διμεθυλεξάνιο
Χημικά αναγνωριστικά
Χημικός τύπος C8H18
Μοριακή μάζα 114,23 amu
Σύντομος
συντακτικός τύπος
(CΗ3)2CHCH(CH3)(CH2)23
Συντομογραφίες iPrCH(CH3)Pr
Αριθμός CAS 584-94-1
SMILES CC(C)C(C)CCC
ChemSpider ID 10963
Ισομέρεια
Ισομερή θέσης 17
Οπτικά ισομερή 2
Φυσικές ιδιότητες
Σημείο τήξης -110 °C
Σημείο βρασμού 115,6 °C
Πυκνότητα 719 kg/m3
Εμφάνιση Άχρωμο υγρό
Χημικές ιδιότητες
Επικινδυνότητα
Εκτός αν σημειώνεται διαφορετικά, τα δεδομένα αφορούν υλικά υπό κανονικές συνθήκες (25°C, 100 kPa).

Το 2,3-διμεθυλεξάνιο (σε δύο οπτικά εναντιομερή) είναι ένα διακλαδισμένο αλκάνιο, δηλαδή άκυκλος κορεσμένος υδρογονάνθρακας, με χημικό τύπο C8H18 και σύντομο συντακτικό τύπο (CΗ3)2CHCH(CH3)(CH2)23.

Ισομέρεια[Επεξεργασία | επεξεργασία κώδικα]

Το 2-μεθυλεπτάνιο έχει τα ακόλουθα δεκαεπτά (17) ισομερή θέσης:

  1. οκτάνιο, με σύντομο συντακτικό τύπο CH3(CH2)6CH3).
  2. 3-μεθυλεπτάνιο, με σύντομο συντακτικό τύπο CH3(CH2)3CH(CH3)CH2CH3 (σε δύο (2) οπτικά ισομερή).
  3. 4-μεθυλεπτάνιο, με σύντομο συντακτικό τύπο [CH3(CH2)2]2CHCH3.
  4. Αιθυλεξάνιο, με σύντομο συντακτικό τύπο (CH3CH2)2CHCH2CH2CH3.
  5. 2-μεθυλεπτάνιο, με σύντομο συντακτικό τύπο (CH3)2CH(CH2)4CH3.
  6. 2,2-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο (CH3)3C(CH2)3CH3.
  7. 2,4-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο (CH3)2CΗCH2CH(CH3)CH2CH3 (σε δύο (2) οπτικά ισομερή).
  8. 2,5-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο (CH3)2CΗCH2CH2CΗ(CH3)2
  9. 3,3-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο CH3CH2C(CH3)2CH2CH2CH3.
  10. 3,4-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο CH3CH2CH(CH3)CH(CH3)CH2CH3 (σε τρία (3) οπτικά ισομερή).
  11. Αιθυλο-2-μεθυλοπεντάνιο, με σύντομο συντακτικό τύπο (CH3CH2)2CHCH(CH3)2.
  12. Αιθυλο-3-μεθυλοπεντάνιο, με σύντομο συντακτικό τύπο (CH3CH2)2C(CH3)2.
  13. 2,2,3-τριμεθυλοπεντάνιο, με σύντομο συντακτικό τύπο CH3CH2CH(CH3)C(CH3)3 (σε δύο (2) οπτικά ισομερή).
  14. 2,2,4-τριμεθυλοπεντάνιο ή ισοκτάνιο, με σύντομο συντακτικό τύπο (CH3)2CHCH2C(CH3)3 (σε δύο (2) οπτικά ισομερή).
  15. 2,3,3-τριμεθυλοπεντάνιο, με σύντομο συντακτικό τύπο CH3CH2C(CH3)2CH(CH3)2.
  16. 2,3,4-τριμεθυλοπεντάνιο, με σύντομο συντακτικό τύπο (CH3)2CHCH(CH3)CH(CH3)2 (σε δύο (2) οπτικά ισομερή).
  17. Tετραμεθυλοβουτάνιο (CH3)3CC(CH3)3.

Ονοματολογία[Επεξεργασία | επεξεργασία κώδικα]

Η ονομασία «2,3-διμεθυλεξάνιο» προέρχεται από την ονοματολογία κατά IUPAC. Συγκεκριμένα, το αρχικό πρόθεμα «διμεθυλο-» δηλώνει την παρουσία δύο (2) όμοιων διακλαδώσεων ενός ατόμου άνθρακα («μεθυλο»), ενωμένα στα άτομα άνθρακα #2 και #3, όπως δηλώνουν οι αρχικοί αριθμοί θέσης («2,3-»), το τμήμα «εξ-» δηλώνει την παρουσία έξι (6) ατόμων άνθρακα στην κύρια ανθρακική αλυσλιδα της ένωσης, το ενδιάμεσο «-αν-» δείχνει την παρουσία μόνο απλών δεσμών μεταξύ ατόμων άνθρακα στο μόριο και η κατάληξη «-ιο» φανερώνει ότι δεν περιέχει χαρακτηριστικές ομάδες που διαθέτουν χαρακτηριστικές καταλήξεις.

Δομή[Επεξεργασία | επεξεργασία κώδικα]

Το μόριό του αποτελείται από οκτώ (8) άτομα άνθρακα (τέσσερα (4) πρωτοταγή,[1] δύο (2) δευτεροταγή[2] και δύο (2) τριτοταγή[3]) και δεκαοκτώ (18) άτομα υδρογόνου.

Δεσμοί[4]
Δεσμός τύπος δεσμού ηλεκτρονική δομή Μήκος δεσμού Ιονισμός
C-H σ 2sp3-1s 109 pm 3% C- H+
C-C σ 2sp3-2sp3 154 pm
Κατανομή φορτίων
σε ουδέτερο μόριο
C#1,#6,#1',#1" -0,09
C#4-#5 -0,06
C#2-#3 -0,03
H +0,03

Παραγωγή[Επεξεργασία | επεξεργασία κώδικα]

Απομόνωση από φυσικές και βιομηχανικές πηγές[Επεξεργασία | επεξεργασία κώδικα]

  1. Απομονώνεται από το πετρέλαιο.
  2. Απομονώνεται από μίγματα που προκύπτουν από πυρόλυση βαρύτερων προϊόντων διύλισης πετρελαίου ή πολυμερών υδρογονανθράκων.

Παραγωγή με αντιδράσεις σύνθεσης: Από πρώτες ύλες με μικρότερη ανθρακική αλυσίδα[Επεξεργασία | επεξεργασία κώδικα]

H σύνθεση 2,3-διμεθυλεξανίου γίνεται και με επίδραση μεθυλολιθίου σε 2,3-διαλεξάνιο:

\mathrm{CH_3X + Li \xrightarrow{|Et_2O|} CH_3Li + LiX}
\mathrm{CH_3CHXCHXCH_2CH_2CH_3 + 2CH_3Li \xrightarrow{} (CH_3)_2CHCH(CH_3)CH_2CH_2CH_3 + 2LiX}

Παραγωγή με αντιδράσεις χωρίς αλλαγή ανθρακικής αλυσίδας[Επεξεργασία | επεξεργασία κώδικα]

Με αναγωγή αλογονούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

Π.χ. το 1-αλο-4,5-διμεθυλεξτάνιο, μπορεί να αναχθεί με τους ακόλουθους τρόπους[5]: 1. Με «υδρογόνο εν τω γεννάσθαι», δηλαδή μέταλλο + οξύ:

 \mathrm{(CH_3)_2CHCH(CH_3)CH_2CH_2CH_2X  + Zn + HX \xrightarrow{} (CH_3)_2CHCH(CH_3)CH_2CH_2CH_3 + ZnX_2}

2. Με λιθιοαργιλιοϋδρίδιο (LiAlH4) ή νατριοβοριοϋδρίδιο (NaBH4)[6]:

 \mathrm{4(CH_3)_2CHCH(CH_3)CH_2CH_2CH_2X + LiAlH_4 \xrightarrow{} 4(CH_3)_2CHCH(CH_3)CH_2CH_2CH_3 + AlX_3 + LiX}

3. Με αναγωγή των αντίστοιχων αλκυλιωδιδίων από HI[7]:

 \mathrm{2((CH_3)_2CHCH(CH_3)CH_2CH_2CH_2X  + HI \xrightarrow{} 2(CH_3)_2CHCH(CH_3)CH_2CH_2CH_3 + I_2}

4. Με αναγωγή από μέταλλα (συνήθως λίθιο ή μαγνήσιο) και στη συνέχεια υδρόλυση των παραγόμενων οργανομεταλλικών ενώσεων.Π.χ.:[8]:

 \mathrm{(CH_3)_2CHCH(CH_3)CH_2CH_2CH_2X + 2Li \xrightarrow[-LiX]{|Et_2O|} (CH_3)_2CHCH(CH_3)CH_2CH_2CH_2Li \xrightarrow{+H_2O} (CH_3)_2CHCH(CH_3)CH_2CH_2CH_3 + LiOH}
ή
 \mathrm{(CH_3)_2CHCH(CH_3)CH_2CH_2CH_2X + Mg \xrightarrow{|Et_2O|} (CH_3)_2CHCH(CH_3)CH_2CH_2CH_2MgX \xrightarrow{+H_2O} (CH_3)_2CHCH(CH_3)CH_2CH_2CH_3 + Mg(OH)X \downarrow}

5. Με αναγωγή από σιλάνιο, παρουσία τριφθοριούχου βορίου, παράγεται 2,2-διμεθυλεξάνιο. Π.χ.:[9]:


\mathrm{(CH_3)_2CHCH(CH_3)CH_2CH_2CH_2X + SiH_4 \xrightarrow{BF_3} (CH_3)_2CHCH(CH_3)CH_2CH_2CH_3  + SiH_3X}

  • Συμπαράγονται και πολυαλογονοπαράγωγα του σιλανίου.

Με αναγωγή οξυγονούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

1. Με αναγωγή των κατάλληλων αλδεϋδών με υδραζίνη (NH2NH2) (αντίδραση Wölf-Kishner) παράγεται 2,3-διμεθυλεξάνιο.[10] Π.χ. για την 4,5-διμεθυλεξανάλη έχουμε την ακόλουθη στοιχειομετρική εξίσωση:

\mathrm{(CH_3)_2CHCH(CH_3)CH_2CH_2CHO + NH_2NH_2 \xrightarrow{KOH} (CH_3)_2CHCH(CH_3)CH_2CH_2CH_3 + N_2 \uparrow + H_2O}

2. Με αναγωγή των κατάλληλων κετονών (αντίδραση Clemmensen) παράγεται 2,3-διμεθυλεξάνιο.[11] Π.χ. για την 4,5-διμεθυλεξανόνη-2 έχουμε την ακόλουθη στοιχειομετρική εξίσωση::

\mathrm{(CH_3)_2CHCH(CH_3)CH_2COCH_3 + 2Zn + 2HCl \xrightarrow{} (CH_3)_2CHCH(CH_3)CH_2CH_2CH_3 + ZnCl_2 + ZnO}

Με αναγωγή θειούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

1. Με αναγωγή των κατάλληλων θειολών (μέθοδος Raney)[12] παράγεται 2,3-διμεθυλεξάνιο. Π.χ. για την 4,5-διμεθυλεξανοθειόλη-1 έχουμε την ακόλουθη στοιχειομετρική εξίσωση:

\mathrm{(CH_3)_2CHCH(CH_3)CH_2CH_2CH_2SH + H_2 \xrightarrow{Ni} (CH_3)_2CHCH(CH_3)CH_2CH_2CH_3 + H_2S}

2. Με αναγωγή των κατάλληλων θειαιθέρων (μέθοδος Raney)[13] παράγεται 2,3-διμεθυλεξάνιο. Π.χ. για το 4,5-διμεθυλο-1-(4΄,5΄-διμεθυλεξυλοθει)εξάνιο χουμε την ακόλουθη στοιχειομετρική εξίσωση

\mathrm{(CH_3)_2CHCH(CH_3)CH_2CH_2CH_2SCH_2CH_2CH_2CH(CH_3)CH(CH_3)_2 + H_2 \xrightarrow{Ni} 2(CH_3)_2CHCH(CH_3)CH_2CH_2CH_3 + H_2S}

Με καταλυτική υδρογόνωση ακόρεστων αλειφατικών υδρογονανθράκων[Επεξεργασία | επεξεργασία κώδικα]

Με καταλυτική υδρογόνωση κατάλληλων ακόρεστων υδρογονανθράκων παράγεται 2,3-διμεθυλεξάνιο. Π.χ. για το 4,5-διμεθυλεξένιο-1 έχουμε την ακόλουθη στοιχειομετρική εξίσωση:

\mathrm{((CH_3)_2CHCH(CH_3)CH_2CH=CH_2 + H_2 \xrightarrow{Ni,\;Pd,\;Pt} (CH_3)_2CHCH(CH_3)CH_2CH_2CH_3}

Παραγωγή με αντιδράσεις αποσύνθεσης με μείωση του μήκους της ανθρακικής αλυσίδας[Επεξεργασία | επεξεργασία κώδικα]

\mathrm{(CH_3)_2CHCH(CH_3)CH_2CH_2CH_2COOH + NaOH \xrightarrow{} (CH_3)_2CHCH(CH_3)CH_2CH_2CH_2COONa + H_2O \xrightarrow{\triangle} (CH_3)_2CHCH(CH_3)CH_2CH_2CH_3 + NaHCO_3 }

Χημικές ιδιότητες[Επεξεργασία | επεξεργασία κώδικα]

Οξείδωση[Επεξεργασία | επεξεργασία κώδικα]

1. Όπως όλα τα αλκάνια, το 2,3-διμεθυλεξάνιο με περίσσεια οξυγόνου καίγεται προς διοξείδιο του άνθρακα και νερό[14]:

\mathrm{2C_8H_{18} + 25O_2 \xrightarrow{\triangle} 16CO_2 + 18H_2O + 10971 J}

  • Αν και η αντίδραση είναι μια έντονα εξώθερμη δεν συμβαίνει σε μέτριες θερμοκρασίες, γιατί για την έναρξή της πρέπει να υπερπηδηθεί πρώτα το εμπόδιο της διάσπασης των δεσμών C-C,[15] των δεσμών C-H[16] και των δεσμών (Ο=Ο)[17] του O2:

2. Παραγωγή υδραερίου:

\mathrm{C_8H_{18} + 8H_2O \xrightarrow[700-1100^oC]{Ni} 8CO + 17H_2}

3. Καταλυτική οξείδωση κυρίως προς σχεδόν ισομοριακό μίγμα 2,3-διμεθυλεξανόλης-2 και 2,3-διμεθυλεξανόλη-3:

\mathrm{(CH_3)_2CHCH(CH_3)CH_2CH_2CH_3 + \frac{1}{2}O_2 \xrightarrow[\triangle]{Cu} \frac{1}{2} (CH_3)_2C(OH)CH(CH_3)CH_2CH_2CH_3 +  \frac{1}{2} (CH_3)_2CHC(OH)(CH_3)CH_2CH_2CH_3 + H_2O}

Παρεμβολή καρβενίων[Επεξεργασία | επεξεργασία κώδικα]

  • Τα καρβένια (π.χ. [:CH2]) μπορούν παρεμβληθούν στους δεσμούς C-H. Π.χ. έχουμε[18]:

\mathrm{(CH_3)_2CHCH(CH_3)CH_2CH_2CH_3  + CH_3Cl + KOH \xrightarrow{} \frac{1}{3} (CH_3)_2CHCH(CH_3)CH_2CH_2CH_2CH_3  + \frac{1}{18} (CH_3)_3CCH(CH_3)CH_2CH_2CH_3  + \frac{1}{18} (CH_3)_2CHC(CH_3)_2CH_2CH_2CH_3 + \frac{1}{9} (CH_3)_2CHCH(CH_3)CH(CH_3)CH_2CH_3 + \frac{1}{9} (CH_3)_2CHCH(CH_3)CH_2CH(CH_3)_2
+ \frac{1}{6} (CH_3)_2CHCH(CH_3)CH_2CH_2CH_2CH_3 + \frac{1}{6} (CH_3)_2CHCH(CH_2CH_3)CH_2CH_2CH_3 + KCl + H_2O}

  • Η αντίδραση είναι ελάχιστα εκλεκτική και αυτό σημαίνει ότι κατά προσέγγιση έχουμε;
  1. Παρεμβολή στους έξι (6) συνολικά δεσμούς C#1,#1΄H2-H. Παράγεται 3,4-διμεθυλεπτάνιο.
  2. Παρεμβολή στον έναν (1) δεσμό C#2-H. Παράγεται 2,2,3-τριμεθυλεξάνιο.
  3. Παρεμβολή στον έναν (1) δεσμό C#3-H. Παράγεται 2,3,3-τριμεθυλεξάνιο.
  4. Παρεμβολή στους δύο (2) δεσμούς C#4H-H. Παράγεται 2,3,4-τριμεθυλεξάνιο.
  5. Παρεμβολή στους δύο (2) δεσμούς C#5H-H. Παράγεται 2,3,5-τριμεθυλεξάνιο.
  6. Παρεμβολή στους τρεις (3) δεσμούς C#6H2-H. Παράγεται 2,3-διμεθυλεπτάνιο.
  7. Παρεμβολή στους τρεις (3) δεσμούς C#1΄΄H2-H. Παράγεται 3-αιθυλο-2-μεθυλεξάνιο.

Προκύπτει επομένως μίγμα 3,4-διμεθυλεπτάνιου (~33%), 2,2,3-τριμεθυλεξάνιου (~5,6%), 2,3,3-τριμεθυλεξάνιου (~5,6%), 2,2,4-τριμεθυλεξάνιου (~11,1%), 2,2,5-τριμεθυλεξάνιου (~11,1%), 2,3-διμεθυλεπτάνιου (~16,7%) και 3-αιθυλο-2-μεθυλεξάνιου (~16,7%).

Καταλυτική ισομερείωση[Επεξεργασία | επεξεργασία κώδικα]

2,3-διμεθυλεξάνιο μπορεί να υποστεί καταλυτική ισομερείωση προς όλα τα ισομερή του.

Aναφορές και σημειώσεις[Επεξεργασία | επεξεργασία κώδικα]

  1. Άτομο C ενωμένο με ένα (1) άλλο άτομο C.
  2. Άτομο C ενωμένο με δύο (2) άλλα άτομα C.
  3. Άτομο C ενωμένο με τρία (3) άλλα άτομα C.
  4. Τα δεδομένα προέρχονται εν μέρει από το «Table of periodic properties of thw Ellements», Sagrent-Welch Scientidic Company και Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, Σελ. 34.
  5. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.2.1β
  6. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, §6.2.1α
  7. Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991, σελ.14, §1.1
  8. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.2.4α.
  9. Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991, σελ. 291-293, §19.1.
  10. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.7.6β.
  11. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.7.6α
  12. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ.269, §11.6B7.
  13. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ.269, §11.6Γ3.
  14. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 155, §6.7.1, v = 8 και μετατροπή μονάδας ενέργειας σε kJ.
  15. ΔHC-C= +347 kJ/mol
  16. ΔHC-H = +415 kJ/mol
  17. ΔHO-O=+146 kJ/mol
  18. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 155, §6.7.3.

Πηγές[Επεξεργασία | επεξεργασία κώδικα]

  • Παπαγεωργίου Β.Π., “Εφαρμοσμένη Οργανική Χημεία: Άκυκλες Ενώσεις”, Εκδόσεις Παρατηρητής, Θεσσαλονίκη 1986.
  • Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982
  • Γ. Βάρβογλη, Ν. Αλεξάνδρου, Οργανική Χημεία, Αθήνα 1972
  • Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991
  • SCHAUM'S OUTLINE SERIES, ΟΡΓΑΝΙΚΗ ΧΗΜΕΙΑ, Μτφ. Α. Βάρβογλη, 1999
  • Μερικές από τις ενέργειες αντιδράσεων υπολογίστηκαν με χρήση κατάλληλου λογισμικού. Θα διασταυρωθούν και βιβλιογραφικά το συντομότερο για μεγαλύτερη ακρίβεια.
Στο λήμμα αυτό έχει ενσωματωθεί κείμενο από το λήμμα 2,3-Dimethylhexane της Αγγλικής Βικιπαίδειας, η οποία διανέμεται υπό την GNU FDL και την CC-BY-SA 3.0. (ιστορικό/συντάκτες).