1,2-διμεθυλοκυκλοπροπάνιο

Από τη Βικιπαίδεια, την ελεύθερη εγκυκλοπαίδεια
Μετάβαση σε: πλοήγηση, αναζήτηση
1,2-διμεθυλοκυκλοπροπάνιο
1 2-DimethylCyclopropane.png
Dimethylcyclopropane.png
Γενικά
Όνομα IUPAC 1,2-διμεθυλοκυκλοπροπάνιο
Χημικά αναγνωριστικά
Χημικός τύπος C5H10
Μοριακή μάζα 70,1 amu
Σύντομος
συντακτικός τύπος
1 2-DimethylCyclopropane.png
Αριθμός CAS 2511-95-7[1]
SMILES CC1CC1C
InChI InChI=1S/C5H10/c1-4-3-5(4)2/h4-5H,3H2,1-2H3[2]
PubChem CID 102832[2]
Δομή
Πόλωση δεσμού C--H+: 3%
Μοριακή γεωμετρία Τα ανθρακοάτομα του δακτυλίου σε επίπεδη τριγωνική θέση.
Ισομέρεια
Ισομερή θέσης 9
Γεωμετρικά ισομερή 2
Φυσικές ιδιότητες
Χημικές ιδιότητες
Θερμότητα πλήρους
καύσης
3.402 kJ/mole
Επικινδυνότητα
Hazard F.svg
Εξαιρετικά εύφλεκτο (F+)
Εκτός αν σημειώνεται διαφορετικά, τα δεδομένα αφορούν υλικά υπό κανονικές συνθήκες (25°C, 100 kPa).

Στη χημεία, το 1,2-διμεθυλοκυκλοπροπάνιο είναι ένα κυκλοαλκάνιο, δηλαδή κορεσμένος υδρογονάνθρακας με δακτύλιο. Έχει δύο γεωμετρικά ισομερή (E-) και (Z-), ανάλογα με τη σχετική θέση των δυο μεθυλίων του σε σχέση με το επίπεδο του τριγώνου που σχηματίζει ο δακτύλιος. Με βάση το χημικό τύπο του, C5H10, έχει εννέα (9) ισομερή θέσεις:

  1. Κυκλοπεντάνιο.
  2. Μεθυλοκυκλοβουτάνιο.
  3. 1,1-διμεθυλοκυκλοπροπάνιο
  4. Αιθυλοκυκλοπροπάνιο.
  5. πεντένιο-1.
  6. Ε,Ζ-πεντένιο-2 (με 2 γεωμερικά ισομερή).
  7. 2-μεθυλοβουτένιο-1.
  8. 3-μεθυλοβουτένιο-1 και
  9. Μεθυλοβουτένιο-2.

Κυκλοπροπάνια[Επεξεργασία | επεξεργασία κώδικα]

«Κυκλοπροπάνια» ονομάζονται τα κυκλοαλκάνια με τριμελή δακτύλιο, που αποτελεί και το χαρακτηριστικό της δομής τους. Οι πλευρικές αλυσίδες, όταν υπάρχουν, διαμορφώνονται όπως στα αλκάνια. Το ιδιαίτερο χαρακτηριστικό της μοριακής δομής τους είναι η εμφάνιση γωνίας δεσμού  \mathrm{\widehat{C-C-C} = 60^o < 109^o28'} που είναι η συνηθισμένη γωνία δεσμού sp3-sp3 που αντιστοιχεί σε κορεσμένο. Ύστερα από ενεργειακή ανάλυση των πιθανών δομών - μοριακών μοντέλων με κβαντομηχανικές μεθόδους προέκυψε ως πιθανότερη η εκδοχή του sp2 υβριδισμού και της δημιουργίας δύο μοριακών τροχιακών τριών κέντρων (των τριών ατόμων C), σ (2sp2-2sp2-2sp2) και π (2p-2p-2p), με 3 ηλεκτρόνια ανά μοριακό τροχιακό, ώστε να χρησιμοποιηθούν τα 6 διαθέσιμα ηλεκτρόνια των 3 ατόμων C (τα άλλα 6 χρησιμοποούνται για τους 6 σ δεσμούς με τα 6 άτομα υδρογόνου ή και τα αλκύλια). Αντί δηλαδή των κλασσικών 3 ομοιοπολικών δεσμών δύο κέντρων μεταξύ των ατόμων C, υπάρχουν 2 ομοιοπολικοί δεσμοί τριών κέντρων.[3]

C3str.png

Εξαιτίας αυτού του γεγονότος προκύπτει η λεγόμενη «ενέργεια τάσης δεσμών» που συνυπολογίζει την ενέργεια παραμόρφωσης δεσμικής γωνίας (κατά Baeyer), που οφείλεται στη διαφορά γωνίας από την κανονική, και την ενέργεια στρέψης (κατά Piltzer), που οφείλεται στην αδυναμία του συστήματος να στρέψει τους δεσμούς του και να πάρει διαμόρρφωση αποφυγής των απώσεων τύπου Van der Waals, που αναπτύσσονται από την προσέγγιση αλληλοαπωθούμενων ατόμων και ομάδων αυτών. Ενώ λοιπόν το ισομερές προπένιο έχει θερμότητα ολικής καύσης 1.971 kcal/mole το κυκλοπροπάνιο έχει 2.088 kcal/mole. Το ΔQ = 117 kJ/mole αντιστοιχεί ακριβώς στην επιπλέον ενέργεια που παγιδεύει η ιδιάζουσα δομή του τριμελή δατυλίου.[4] Αποτέλεσμα των παραπάνω είναι τα κυκλοπροπάνια να δείνουν αντιδράσεις προσθηκοδιάσπασης-1,3.

Παρασκευές[Επεξεργασία | επεξεργασία κώδικα]

Ενδομοριακή αντίδραση Würz[Επεξεργασία | επεξεργασία κώδικα]

Με την τροποποιημένη αντίδραση Freund με Zn, που δίνει μεγαλύτερη απόδοση στην ενδομοριακή αντίδραση. Σ' αυτήν την περίπτωση η στοιχειομετρική εξίσωση της αντίδρασης γίνεται[5][6]:

 \mathrm{CH_3CHBrCH_2CHBrCH_3 + Zn \xrightarrow{} ZnBr_2 +} 1 2-DimethylCyclopropane.png

Με χρήση καρβενίου[Επεξεργασία | επεξεργασία κώδικα]

Με προσθήκη μεθυλενίου σε μεθυλοπροπενίου και χρήση συστήματος διωδομεθάνιου (ZnI2), ψευδαργύρου (Zn) και χαλκού (Cu)[7]:


\mathrm{CH_3CH=CHCH_3 + CH_2I_2 + Zn \xrightarrow{Cu} ZnI_2 +} 1 2-DimethylCyclopropane.png

Χημικές ιδιότητες[Επεξεργασία | επεξεργασία κώδικα]

Οξείδωση[Επεξεργασία | επεξεργασία κώδικα]

1. Όπως όλα τα κυκλοαλκάνια, το 1,2-διμεθυλοκυκλοπροπάνιο με περίσσεια οξυγόνου καίγεται προς διοξείδιο του άνθρακα και νερό [8][9]:

1 2-DimethylCyclopropane.png\mathrm{+ \frac{15}{2}O_2 \xrightarrow{\triangle} 5CO_2 + 5H_2O + 3402 \; J}

  • Αν και η αντίδραση είναι μια έντονα εξώθερμη δεν συμβαίνει σε μέτριες θερμοκρασίες, γιατί για την έναρξή της πρέπει να υπερπηδηθεί πρώτα το εμπόδιο της διάσπασης των δεσμών C-C,[10] των δεσμών C-H[11] και των δεσμών (Ο=Ο)[12] του O2:

2. Παραγωγή υδραερίου:

1 2-DimethylCyclopropane.png \mathrm{+ 5H_2O \xrightarrow[700-1100^oC]{Ni} 5CO + 10H_2}

3. Καταλυτική οξυγόνωση. Με έντονες οξειδωτικές συνθήκες δίνει αντίδραση προσθηκοδιάσπασης-1,3 προς μίγμα 2,3-διμεθυλοξετάνιου και 2,4-διμεθυλοξετάνιου:

1 2-DimethylCyclopropane.png  \mathrm{+ \frac{1}{2}O_2 \xrightarrow[1-2MPa,\triangle]{Ag} \frac{2}{3}} 2,3-dimethyloxetane.png\mathrm{+ \frac{1}{3}} 2,4-dimethyloxetane.png

4. Με υπερμαγγανικό κάλιο προς 1,2-διμεθυλοκυκλοπρονόλη:

1 2-DimethylCyclopropane.png \mathrm{+ 2KMnO_4 + H_2SO_4 \xrightarrow{} 2MnO_2 + K_2SO_4 + H_2O +} 1,2-dimethylcyclopropanole.png

Επίδραση καρβενίων[Επεξεργασία | επεξεργασία κώδικα]

  • Το 1,2-διμεθυλοκυκλοπροπάνιο έχει 10 άτομα υδρογόνου για παρεμβολή καρβενίων[13]:

1 2-DimethylCyclopropane.png \mathrm{+ CH_3Cl + KOH \xrightarrow{} KCl + H_2O + \frac{3}{5}} 1-ethyl-2-methylcyclopropane.png \mathrm{+\frac{1}{5}} 1,1,2-triimethylcyclopropane.png \mathrm{+\frac{1}{5}} 1,2,3-trimethylcyclopropane.png

  • Η αντίδραση είναι ελάχιστα εκλεκτική και αυτό σημαίνει ότι κατά προσέγγιση έχουμε:
1. Παρεμβολή στους έξι (6) δεσμούς CH2-H: 6.
2. Παρεμβολή στους δύο (2) δεσμούς CH-H: 2.
2. Παρεμβολή στους δύο (2) δεσμούς C-H: 2.

Προκύπτει επομένως μίγμα 1-αιθυλο-2-μεθυλοκυκλοκυκλοπροπάνιου ~60%, 1,1,2-τριμεθυλοκυκλοπροπάνιου ~20% και 1,2,3-τριμεθυλοκυκλοπροπάνιου 20%.

Νίτρωση[Επεξεργασία | επεξεργασία κώδικα]

  • Αντιδρά με ατμούς HNO3 στην αέρια φάση[14]:

1 2-DimethylCyclopropane.png  \mathrm{+ HNO_3 \xrightarrow{\triangle} + H_2O + a}  1,2-dimethyl-1-nitro-cyclopropane.png \mathrm{+b} 1,2,3-trimethylcyclopropane.png \mathrm{+c} (2-methylcyclopropyl)-nitromethane.png

όπου a, b, c > 0, a + b + c = 1.

Καταλυτική υδρογόνωση με 1,3-Προσθηκοδιάσπαση[Επεξεργασία | επεξεργασία κώδικα]

  • Ο όρος «προσθηκοδιάσπαση» σημαίνει προσθήκη με διάσπαση δακτυλίου.

Με καταλυτική υδρογόνωση - Παράγεται μίγμα μεθυλοβουτάνιου και πεντάνιου:

1 2-DimethylCyclopropane.png  \mathrm{+ H_2 \xrightarrow{Pt} \frac{2}{3} (CH_3)_2CHCH_2CH_3 +  \frac{1}{3} CH_3(CH_2)_3CH_3}

Υδραλογόνωση-1,3[Επεξεργασία | επεξεργασία κώδικα]

Με υδραλογόνο (ΗΧ) - Παράγεται μίγμα 2-αλο-3-μεθυλοβουτάνιου και πεντυλοαλογονιδίου-2:

1 2-DimethylCyclopropane.png  \mathrm{+ HX \xrightarrow{} \frac{2}{3} (CH_3)_2CHCH(X)CH_3 + \frac{1}{3}CH_3CH_2CH_2CH(X)CH_3}

Υδροξυαλογόνωση-1,3[Επεξεργασία | επεξεργασία κώδικα]

Με υπαλογονώδες οξύ (HOX) - Παράγεται μίγμα 3-μεθυλο-4-αλοβουτανόλης-2 και 4-αλοπεντανόλης-2:

1 2-DimethylCyclopropane.png  \mathrm{+ HOX \xrightarrow{}  \frac{2}{3} XCH_2CH(CH_3)CH(OH)CH_3 + \frac{1}{3}CH_3CH(X)CH_2CH(OH)CH_3}

Ενυδάτωση-1,3[Επεξεργασία | επεξεργασία κώδικα]

Με επίδραση θειικού οξέος σε 1,2-διμεθυλοκυκλοπροπάνιo παράγεται μίγμα μονοεστέρων του θειικού οξέος, που υδρολύεται σχηματίζοντας μίγμα 3-μεθυλοβουτανόλης-2 και πεντανόλης-2:

1 2-DimethylCyclopropane.png  \mathrm{+ H_2SO_4 \xrightarrow{} \frac{2}{3} (CH_3)_2CHCH(OSO_3H)CH_3 + \frac{1}{3}CH_3CH_2CH_2CH(OSO_3H)CH_3 \xrightarrow[-H_2SO_4]{+H_2O} \frac{2}{3} (CH_3)_2CHCH(OH)CH_3 + \frac{1}{3}CH_3CH_2CH_2CH(OH)CH_3}

Διυδροξυλίωση-1,3[Επεξεργασία | επεξεργασία κώδικα]

Με επίδραση υπεροξείδιο του υδρογόνου σε 1,2-διμεθυλοκυκλοπροπάνιo, παρουσία καρβονικών οξέων παράγεται μίγμα 2-μεθυλοβουτανoδιόλης-1,3 και πεντανοδιόλης-2,4:

1 2-DimethylCyclopropane.png  \mathrm{ + H_2O_2 \xrightarrow{RCOOH} \frac{2}{3} CH_3CH(OH)CH(CH_3)CH_2OH + \frac{1}{3} CH_3CH(OH)CH_2CH(OH)CH_3}

Αναφορές και παρατηρήσεις[Επεξεργασία | επεξεργασία κώδικα]

  1. [1]
  2. 2,0 2,1 [2]
  3. Ν. Αλεξάνδρου, Γενική Οργανική Χημεία, ΘΕΣΣΑΛΟΝΙΚΗ 1985: Σελ.127-128, §6.2.
  4. Ν. Αλεξάνδρου, Γενική Οργανική Χημεία, ΘΕΣΣΑΛΟΝΙΚΗ 1985, Σελ. 125-126, §6.1.
  5. G. Gustavson (1887). "Ueber eine neue Darstellungsmethode des Trimethylens". J. Prakt. Chem. 36: 300–305. doi:10.1002/prac.18870360127. http://gallica.bnf.fr/ark:/12148/bpt6k90799n/f308.table.
  6. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 154, §6.5.Β1.
  7. SCHAUM'S OUTLINE SERIES, ΟΡΓΑΝΙΚΗ ΧΗΜΕΙΑ, Μτφ. Α. Βάρβογλη, 1999, σελ. 138, §9.2Β5β.
  8. Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991, σελ.21, §1.1.
  9. Ν. Αλεξάνδρου, Γενική Οργανική Χημεία, ΘΕΣΣΑΛΟΝΙΚΗ 1985: Σελ.126, 6.1.
  10. ΔHC-C= +347 kJ/mol
  11. ΔHC-H = +415 kJ/mol
  12. ΔHO-O=+146 kJ/mol
  13. SCHAUM'S OUTLINE SERIES, ΟΡΓΑΝΙΚΗ ΧΗΜΕΙΑ, Μτφ. Α. Βάρβογλη, 1999, σελ. 46 §4.4.4.
  14. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982: Σελ. 244, §10.3.2.

Πηγές[Επεξεργασία | επεξεργασία κώδικα]

  • Γ. Βάρβογλη, Ν. Αλεξάνδρου, Οργανική Χημεία, Αθήνα 1972
  • Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991
  • SCHAUM'S OUTLINE SERIES, ΟΡΓΑΝΙΚΗ ΧΗΜΕΙΑ, Μτφ. Α. Βάρβογλη, 1999
  • Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982
  • [3]