2,2-διμεθυλεξάνιο

Από τη Βικιπαίδεια, την ελεύθερη εγκυκλοπαίδεια
Μετάβαση σε: πλοήγηση, αναζήτηση
2,2-διμεθυλεξάνιο
Γενικά
Όνομα IUPAC 2,2-διμεθυλεξάνιο
Χημικά αναγνωριστικά
Χημικός τύπος C8H18
Μοριακή μάζα 114,23 amu
Σύντομος
συντακτικός τύπος
(CΗ3)3C(CH2)33
Συντομογραφίες tBuBu
Αριθμός CAS 590-73-8[1]
SMILES CC(C)(C)CCCC
Αριθμός EINECS 209-689-4
PubChem CID 24847032[2]
Ισομέρεια
Ισομερή θέσης 17
Φυσικές ιδιότητες
Σημείο βρασμού 107 °C
Πυκνότητα 693 kg/m3
Δείκτης διάθλασης ,
nD
1,393
Τάση ατμών 34 mmHg (25 °C)
8,411 kPa (37,7 °C)
Εμφάνιση Άχρωμο υγρό
Χημικές ιδιότητες
Βαθμός οκτανίου 77,4[3]
Ελάχιστη θερμοκρασία
ανάφλεξης
-3,33 °C
Επικινδυνότητα
Hazard F.svg Hazard X.svg Hazard N.svg
Εξαιρετικά εύφλεκτο (F+), Επιβλαβές (Xn), Τοξικό για τους υδρόβιους οργανισμούς (N)
Φράσεις κινδύνου R 11, R 38, R 50/5, R 65, R 67
Φράσεις ασφαλείας S 02, S 09, S 16, S 24, S 29, S 33, S 36, S 61, S 62
Κίνδυνοι κατά
NFPA 704

NFPA 704.svg

3
0
0
 
Εκτός αν σημειώνεται διαφορετικά, τα δεδομένα αφορούν υλικά υπό κανονικές συνθήκες (25°C, 100 kPa).

Το 2,2-διμεθυλεξάνιο είναι ένα διακλαδισμένο αλκάνιο, δηλαδή άκυκλος κορεσμένος υδρογονάνθρακας, με χημικό τύπο C8H18 και σύντομο συντακτικό τύπο (CH3)3C(CH2)3CH3

Ισομέρεια[Επεξεργασία | επεξεργασία κώδικα]

Το 2-μεθυλεπτάνιο έχει τα ακόλουθα δεκαεπτά (17) ισομερή θέσης:

  1. οκτάνιο, με σύντομο συντακτικό τύπο CH3(CH2)6CH3).
  2. 3-μεθυλεπτάνιο, με σύντομο συντακτικό τύπο CH3(CH2)3CH(CH3)CH2CH3 (σε δύο (2) οπτικά ισομερή).
  3. 4-μεθυλεπτάνιο, με σύντομο συντακτικό τύπο [CH3(CH2)2]2CHCH3.
  4. Αιθυλεξάνιο, με σύντομο συντακτικό τύπο (CH3CH2)2CHCH2CH2CH3.
  5. 2-μεθυλεπτάνιο, με σύντομο συντακτικό τύπο (CH3)2CH(CH2)4CH3.
  6. 2,3-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο (CH3)2CΗCH(CH3)CH2CH2CH3 (σε δύο (2) οπτικά ισομερή).
  7. 2,4-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο (CH3)2CΗCH2CH(CH3)CH2CH3 (σε δύο (2) οπτικά ισομερή).
  8. 2,5-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο (CH3)2CΗCH2CH2CΗ(CH3)2
  9. 3,3-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο CH3CH2C(CH3)2CH2CH2CH3.
  10. 3,4-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο CH3CH2CH(CH3)CH(CH3)CH2CH3 (σε τρία (3) οπτικά ισομερή).
  11. Αιθυλο-2-μεθυλοπεντάνιο, με σύντομο συντακτικό τύπο (CH3CH2)2CHCH(CH3)2.
  12. Αιθυλο-3-μεθυλοπεντάνιο, με σύντομο συντακτικό τύπο (CH3CH2)2C(CH3)2.
  13. 2,2,3-τριμεθυλοπεντάνιο, με σύντομο συντακτικό τύπο CH3CH2CH(CH3)C(CH3)3 (σε δύο (2) οπτικά ισομερή).
  14. 2,2,4-τριμεθυλοπεντάνιο ή ισοκτάνιο, με σύντομο συντακτικό τύπο (CH3)2CHCH2C(CH3)3 (σε δύο (2) οπτικά ισομερή).
  15. 2,3,3-τριμεθυλοπεντάνιο, με σύντομο συντακτικό τύπο CH3CH2C(CH3)2CH(CH3)2.
  16. 2,3,4-τριμεθυλοπεντάνιο, με σύντομο συντακτικό τύπο (CH3)2CHCH(CH3)CH(CH3)2 (σε δύο (2) οπτικά ισομερή).
  17. Tετραμεθυλοβουτάνιο (CH3)3CC(CH3)3.

Ονοματολογία[Επεξεργασία | επεξεργασία κώδικα]

Η ονομασία «2,2-διμεθυλεξάνιο» προέρχεται από την ονοματολογία κατά IUPAC. Συγκεκριμένα, το αρχικό πρόθεμα «διμεθυλο-» δηλώνει την παρουσία δύο (2) όμοιων διακλαδώσεων, για την ακρίβεια ενωμένα και τα δύο με το άτομο #2 άνθρακα της κύριας ανθρακική αλυσίδας, όπως δείχνει το και τα δυο («δι-») ενός (1) ατόμου άνθρακα («-μεθυλο-») και συγκεκριμένα και οι δυο στο άτομο άνθρακα #2, όπως δηλώνουν οι αρχικοί αριθμοί θέσης («2,2-»), το τμήμα «εξ-» δηλώνει την παρουσία έξι (6) ατόμων άνθρακα στην κύρια ανθρακική αλυσλιδα της ένωσης, το ενδιάμεσο «-αν-» δείχνει την παρουσία μόνο απλών δεσμών μεταξύ ατόμων άνθρακα στο μόριο και η κατάληξη «-ιο» φανερώνει ότι δεν περιέχει χαρακτηριστικές ομάδες που διαθέτουν χαρακτηριστικές καταλήξεις.

Δομή[Επεξεργασία | επεξεργασία κώδικα]

Το μόριό του αποτελείται από οκτώ (8) άτομα άνθρακα (τέσσερα (4) πρωτοταγή[4], τρία (3) δευτεροταγή[5] και ένα (1) τεταρτοταγές[6]) και δεκαοκτώ (18) άτομα υδρογόνου.

Δεσμοί[7]
Δεσμός τύπος δεσμού ηλεκτρονική δομή Μήκος δεσμού Ιονισμός
C-H σ 2sp3-1s 109 pm 3% C- H+
C-C σ 2sp3-2sp3 154 pm
Κατανομή φορτίων
σε ουδέτερο μόριο
C#1,#6,#1',#1" -0,09
C#3-#5 -0,06
C#2 0,00
H +0,03

Παραγωγή[Επεξεργασία | επεξεργασία κώδικα]

Απομόνωση από φυσικές και βιομηχανικές πηγές[Επεξεργασία | επεξεργασία κώδικα]

  1. Απομονώνεται από το πετρέλαιο.
  2. Απομονώνεται από μίγματα που προκύπτουν από πυρόλυση βαρύτερων προϊόντων διύλισης πετρελαίου ή πολυμερών υδρογονανθράκων.

Παραγωγή με αντιδράσεις σύνθεσης: Από πρώτες ύλες με μικρότερη ανθρακική αλυσίδα[Επεξεργασία | επεξεργασία κώδικα]

1. Δομικά το 2,2-διμεθυλεξτάνιο αποτελείται από τριτοταγές βουτύλιο ((CH3)3C-) και ένα βουτύλιο (-CH2CH2CH2CH3). Επομένως, ο απλούστερος τρόπος παρασκευής καθαρού ισοεπτανίου είναι η αντίδραση ζεύγους τριτοταγούς βουτυλολίθιου με βουτυλαλογονίδιο ή αντίστροφα τριτοταγές βουτυλαλογονίδιου με βουτυλολίθιο:



ή

2. Εναλλακτικά γίνεται η σύνθεση 2,2-διμεθυλεξανίου γίνεται και με επίδραση μεθυλολιθίου σε 2,2-διαλεξάνιο:



Παραγωγή με αντιδράσεις χωρίς αλλαγή ανθρακικής αλυσίδας[Επεξεργασία | επεξεργασία κώδικα]

Με αναγωγή αλογονούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

Κατάλληλα για παραγωγή 2,2-διμεθυλεξάνιου είναι τα ακόλουθα αλκυλαλογονίδια:

  1. 1-αλο-2,2-διμεθυλεξάνιο.
  2. 3-αλο-2,2-διμεθυλεξάνιο.
  3. 3-αλο-5,5-διμεθυλεξάνιο.
  4. 2-αλο-5,5-διμεθυλεξάνιο.
  5. 1-αλο-5,5-διμεθυλεξάνιο.
  • Καθένα από αυτά, π.χ. το 1-αλο-5,5-διμεθυλεξτάνιο, μπορεί να αναχθεί με τους ακόλουθους τρόπους[8]:

1. Με «υδρογόνο εν τω γεννάσθαι», δηλαδή μέταλλο + οξύ:

2. Με λιθιοαργιλιοϋδρίδιο (LiAlH4) ή νατριοβοριοϋδρίδιο (NaBH4)[9]:

3. Με αναγωγή των αντίστοιχων αλκυλιωδιδίων από HI[10]:

4. Με αναγωγή από μέταλλα (συνήθως λίθιο ή μαγνήσιο) και στη συνέχεια υδρόλυση των παραγόμενων οργανομεταλλικών ενώσεων.Π.χ.:[11]:


ή

5. Με αναγωγή από σιλάνιο, παρουσία τριφθοριούχου βορίου, παράγεται 2,2-διμεθυλεξάνιο. Π.χ.:[12]:

  • Συμπαράγονται και πολυαλογονοπαράγωγα του σιλανίου.
  • Στην παραπάνω λίστα αναφέρθηκαν μόνο οι κατάλληλες αλογονούχες ενώσεις με ένα άτομο αλογόνου ανά μόριο. Υπάρχουν όμως και πολυπλοκότερες, με περισσότερα άτομα αλογόνων ανά μόριο, που μπορούν να επίσης να δώσουν 2,2-διμε8υλεξάνιο.

Με αναγωγή οξυγονούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

1. Με αναγωγή 2,2-διμεθυλεξανάλης ή 5,5-διμεθυλεξανάλης με υδραζίνη (NH2NH2) (αντίδραση Wölf-Kishner) παράγεται 2,2-διμεθυλεξάνιο[13]. Π.χ. για την 5,5-διμεθυλεξανάλη έχουμε την ακόλουθη στοιχειομετρική εξίσωση:

2. Με αναγωγή 5,5-διμεθυλεξανόνης-2 ή 5,5-διμεθυλεξανόνης-3 ή 2,2-διμεθυλεξανόνης-3 (Αντίδραση Clemmensen) παράγεται 2,2-διμεθυλεξάνιο[14]. Π.χ. για την 5,5-διμεθυλεξανόνη-2 έχουμε την ακόλουθη στοιχειομετρική εξίσωση::

  • Παραπάνω αναφέρθηκαν μόνο οι κατάλληλες οξυγονούχες ενώσεις με ένα άτομο οξυγόνου ανά μόριο. Υπάρχουν όμως και πολυπλοκότερες, με περισσότερα άτομα οξυγόνου ανά μόριο, που μπορούν να επίσης να δώσουν 2,2-διμε8υλεξάνιο.

Με αναγωγή θειούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

1. Με αναγωγή των κατάλληλων θειολών (μέθοδος Raney)[15] παράγεται 2,2-διμεθυλεξάνιο. Για την παραγωγή του 2,2-διμεθυλεξάνιου κατάλληλες είναι οι ακόλουθες θειόλες:

  1. 2,2-διμεθυλεξανοθειόλη-1.
  2. 2,2-διμεθυλεξανοθειόλη-3.
  3. 5,5-διμεθυλεξανοθειόλη-3.
  4. 5,5-διμεθυλεξανοθειόλη-2.
  5. 5,5-διμεθυλεξανοθειόλη-1.

Π.χ. για την 5,5-διμεθυλεξανοθειόλη-1 έχουμε την ακόλουθη στοιχειομετρική εξίσωση:

2. Με αναγωγή των κατάλληλων θειαιθέρων (μέθοδος Raney)[16] παράγεται 2,2-διμεθυλεξάνιο. Π.χ. για το 5,5-διμεθυλο-1-(5΄,5΄-διμεθυλεξυλοθει)εξάνιο χουμε την ακόλουθη στοιχειομετρική εξίσωση

Με καταλυτική υδρογόνωση ακόρεστων αλειφατικών υδρογονανθράκων[Επεξεργασία | επεξεργασία κώδικα]

Με καταλυτική υδρογόνωση κατάλληλων ακόρεστων υδρογονανθράκων παράγεται 2,2-διμεθυλεξάνιο. Π.χ. για το 5,5-διμεθυλεξένιο-1 έχουμε την ακόλουθη στοιχειομετρική εξίσωση:

Παραγωγή με αντιδράσεις αποσύνθεσης με μείωση του μήκους της ανθρακικής αλυσίδας[Επεξεργασία | επεξεργασία κώδικα]

Χημικές ιδιότητες[Επεξεργασία | επεξεργασία κώδικα]

Οξείδωση[Επεξεργασία | επεξεργασία κώδικα]

1. Όπως όλα τα αλκάνια, το 2,2-διμεθυλεξάνιο με περίσσεια οξυγόνου καίγεται προς διοξείδιο του άνθρακα και νερό[17]:

  • Αν και η αντίδραση είναι μια έντονα εξώθερμη δεν συμβαίνει σε μέτριες θερμοκρασίες, γιατί για την έναρξή της πρέπει να υπερπηδηθεί πρώτα το εμπόδιο της διάσπασης των δεσμών C-C[18], των δεσμών C-H[19] και των δεσμών (Ο=Ο)[20] του O2:

2. Παραγωγή υδραερίου:

3. Καταλυτική οξείδωση κυρίως προς σχεδόν ισομοριακό μίγμα 2,2-διμεθυλεξανόνης-3, 5,5-διμεθυλεξανόνης-3 και 5,5-διμεθυλεξανόνης-2:

Παρεμβολή καρβενίων[Επεξεργασία | επεξεργασία κώδικα]

  • Τα καρβένια (π.χ. [:CH2]) μπορούν παρεμβληθούν στους δεσμούς C-H. Π.χ. έχουμε[21]:

  • Η αντίδραση είναι ελάχιστα εκλεκτική και αυτό σημαίνει ότι κατά προσέγγιση έχουμε;
  1. Παρεμβολή στους εννέα (9) συνολικά δεσμούς C#1,#1΄,#1΄΄H2-H. Παράγεται 3,3-διμεθυλεπτάνιο.
  2. Παρεμβολή στους δύο (2) δεσμούς C#3H-H. Παράγεται 2,2,3-τριμεθυλεξάνιο.
  3. Παρεμβολή στους δύο (2) δεσμούς C#4H-H. Παράγεται 2,2,4-τριμεθυλεξάνιο.
  4. Παρεμβολή στους δύο (2) δεσμούς C#5H-H. Παράγεται 2,2,5-τριμεθυλεξάνιο.
  5. Παρεμβολή στους τρεις (3) δεσμούς C#6H2-H. Παράγεται 2,2-διμεθυλεπτάνιο.

Προκύπτει επομένως μίγμα 3,3-διμεθυλεπτάνιου (~50%), 2,2,3-τριμεθυλεξάνιου (~11,1%), 2,2,4-τριμεθυλεξάνιου (~11,1%), 2,2,5-τριμεθυλεξάνιου (~11,1%) και 2,2-διμεθυλεπτάνιου (~16,7%).

Καταλυτική ισομερείωση[Επεξεργασία | επεξεργασία κώδικα]

2,2-διμεθυλεξάνιο μπορεί να υποστεί καταλυτική ισομερείωση προς όλα τα ισομερή του.

Aναφορές και σημειώσεις[Επεξεργασία | επεξεργασία κώδικα]

  1. Διαδικτυακός τόπος thegoodscentscompany
  2. http://www.sigmaaldrich.com/catalog/ProductDetail.do?D7=0&N5=SEARCH_CONCAT_PNO%7CBRAND_KEY&N4=111457%7CALDRICH&N25=0&QS=ON&F=SPEC | Διαδικυακός τόπος sigmaaldrich
  3. API Data Book Values, APIDATA.XLS
  4. Άτομο C ενωμένο με ένα (1) άλλο άτομο C.
  5. Άτομο C ενωμένο με δύο (2) άλλα άτομα C.
  6. Άτομο C ενωμένο με τέσσερα (4) άλλα άτομα C.
  7. Τα δεδομένα προέρχονται εν μέρει από το «Table of periodic properties of thw Ellements», Sagrent-Welch Scientidic Company και Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, Σελ. 34.
  8. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.2.1β
  9. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, §6.2.1α
  10. Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991, σελ.14, §1.1
  11. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.2.4α.
  12. Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991, σελ. 291-293, §19.1.
  13. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.7.6β.
  14. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.7.6α
  15. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ.269, §11.6B7.
  16. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ.269, §11.6Γ3.
  17. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 155, §6.7.1, v = 8 και μετατροπή μονάδας ενέργειας σε kJ.
  18. ΔHC-C= +347 kJ/mol
  19. ΔHC-H = +415 kJ/mol
  20. ΔHO-O=+146 kJ/mol
  21. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 155, §6.7.3.

Πηγές[Επεξεργασία | επεξεργασία κώδικα]

  • Παπαγεωργίου Β.Π., “Εφαρμοσμένη Οργανική Χημεία: Άκυκλες Ενώσεις”, Εκδόσεις Παρατηρητής, Θεσσαλονίκη 1986.
  • Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982
  • Γ. Βάρβογλη, Ν. Αλεξάνδρου, Οργανική Χημεία, Αθήνα 1972
  • Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991
  • SCHAUM'S OUTLINE SERIES, ΟΡΓΑΝΙΚΗ ΧΗΜΕΙΑ, Μτφ. Α. Βάρβογλη, 1999
  • Μερικές από τις ενέργειες αντιδράσεων υπολογίστηκαν με χρήση κατάλληλου λογισμικού. Θα διασταυρωθούν και βιβλιογραφικά το συντομότερο για μεγαλύτερη ακρίβεια.