Αιθυλεξάνιο

Από τη Βικιπαίδεια, την ελεύθερη εγκυκλοπαίδεια
Πήδηση στην πλοήγηση Πήδηση στην αναζήτηση
Αιθυλεξάνιο
Γενικά
Όνομα IUPAC Αιθυλεξάνιο
Χημικά αναγνωριστικά
Χημικός τύπος C8H18
Μοριακή μάζα 114,23 amu[1]
Σύντομος
συντακτικός τύπος
(CΗ3CH2)2CH(CH2)2CH3
Συντομογραφίες Et2CHPr
Αριθμός CAS 619-99-8[2]
SMILES CCC(CC)CCC
ChemSpider ID 11599
Ισομέρεια
Ισομερή θέσης 17
Φυσικές ιδιότητες
Σημείο βρασμού 117,5 °C
Πυκνότητα 709 kg/m3
Τάση ατμών 20,7 mmHg (25 °C)
Εμφάνιση Άχρωμο υγρό
Χημικές ιδιότητες
Βαθμός οκτανίου 52,4[3]
Ελάχιστη θερμοκρασία
ανάφλεξης
10,4 °C
Επικινδυνότητα
Εκτός αν σημειώνεται διαφορετικά, τα δεδομένα αφορούν υλικά υπό κανονικές συνθήκες (25°C, 100 kPa).

Το αιθυλεξάνιο είναι ένα διακλαδισμένο αλκάνιο, δηλαδή άκυκλος κορεσμένος υδρογονάνθρακας, με χημικό τύπο C8H18 και σύντομο συντακτικό τύπο (CΗ3CH2)2CH(CH2)2CH3.

Ισομέρεια[Επεξεργασία | επεξεργασία κώδικα]

Το αιθυλεξάνιο έχει τα ακόλουθα δεκαεπτά (17) ισομερή θέσης:

  1. οκτάνιο, με σύντομο συντακτικό τύπο CH3(CH2)6CH3).
  2. 3-μεθυλεπτάνιο, με σύντομο συντακτικό τύπο CH3(CH2)3CH(CH3)CH2CH3 (σε δύο (2) οπτικά ισομερή).
  3. 2-μεθυλεπτάνιο, με σύντομο συντακτικό τύπο3(CH2)2CH(CH3)CH2)23.
  4. 4-μεθυλεπτάνιο, με σύντομο συντακτικό τύπο3(CH2)2CH(CH3)CH2)23.
  5. 2,2-διμεθυλεξάνιο ή νεοοκτάνιο, με σύντομο συντακτικό τύπο (CH3)3C(CH2)3CH3.
  6. 2,3-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο (CH3)2CΗCH(CH3)CH2CH2CH3 (σε δύο (2) οπτικά ισομερή).
  7. 2,4-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο (CH3)2CΗCH2CH(CH3)CH2CH3 (σε δύο (2) οπτικά ισομερή).
  8. 2,5-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο (CH3)2CΗCH2CH2CΗ(CH3)2
  9. 3,3-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο CH3CH2C(CH3)2CH2CH2CH3.
  10. 3,4-διμεθυλεξάνιο, με σύντομο συντακτικό τύπο CH3CH2CH(CH3)CH(CH3)CH2CH3 (σε τρία (3) οπτικά ισομερή).
  11. Αιθυλο-2-μεθυλοπεντάνιο, με σύντομο συντακτικό τύπο (CH3CH2)2CHCH(CH3)2.
  12. Αιθυλο-3-μεθυλοπεντάνιο, με σύντομο συντακτικό τύπο (CH3CH2)2C(CH3)2.
  13. 2,2,3-τριμεθυλοπεντάνιο, με σύντομο συντακτικό τύπο CH3CH2CH(CH3)C(CH3)3 (σε δύο (2) οπτικά ισομερή).
  14. 2,2,4-τριμεθυλοπεντάνιο ή ισοκτάνιο, με σύντομο συντακτικό τύπο (CH3)2CHCH2C(CH3)3 (σε δύο (2) οπτικά ισομερή).
  15. 2,3,3-τριμεθυλοπεντάνιο, με σύντομο συντακτικό τύπο CH3CH2C(CH3)2CH(CH3)2.
  16. 2,3,4-τριμεθυλοπεντάνιο, με σύντομο συντακτικό τύπο (CH3)2CHCH(CH3)CH(CH3)2 (σε δύο (2) οπτικά ισομερή).
  17. Tετραμεθυλοβουτάνιο (CH3)3CC(CH3)3.

Ονοματολογία[Επεξεργασία | επεξεργασία κώδικα]

Η ονομασία «αιθυλεξάνιο» από την ονοματολογία κατά IUPAC. Συγκεκριμένα, το αρχικό πρόθεμα «αιθυλ-» δηλώνει την παρουσία διακλάδωσης δύο (2) ατόμων άνθρακα, το τμήμα «εξ-» δηλώνει την παρουσία έξι (6) ατόμων άνθρακα στην κύρια ανθρακική αλυσίδα της ένωσης, το ενδιάμεσο «-αν-» δείχνει την παρουσία μόνο απλών δεσμών μεταξύ ατόμων άνθρακα στο μόριο και η κατάληξη «-ιο» φανερώνει ότι δεν περιέχει χαρακτηριστικές ομάδες, δηλαδή ότι είναι υδρογονάνθρακας.

Δομή[Επεξεργασία | επεξεργασία κώδικα]

Το μόριό του αποτελείται από οκτώ (8) άτομα άνθρακα (τρία (3) πρωτοταγή[4], τέσσερα (4) δευτεροταγή[5] και ένα (1) τριτοταγές[6]) και δεκαοκτώ (18) άτομα υδρογόνου.

Δεσμοί[7]
Δεσμός τύπος δεσμού ηλεκτρονική δομή Μήκος δεσμού Ιονισμός
C-H σ 2sp3-1s 109 pm 3% C- H+
C-C σ 2sp3-2sp3 154 pm
Κατανομή φορτίων
σε ουδέτερο μόριο
C#1,#6,#2΄ -0,09
C#2,#3,#4,#1΄ -0,06
C#3 -0,03
H +0,03

Παραγωγή[Επεξεργασία | επεξεργασία κώδικα]

Απομόνωση από φυσικές και βιομηχανικές πηγές[Επεξεργασία | επεξεργασία κώδικα]

  1. Απομονώνεται από το πετρέλαιο.
  2. Απομονώνεται από μίγματα που προκύπτουν από πυρόλυση βαρύτερων προϊόντων διύλισης πετρελαίου ή πολυμερών υδρογονανθράκων.

Παραγωγή με αντιδράσεις σύνθεσης: Από πρώτες ύλες με μικρότερη ανθρακική αλυσίδα[Επεξεργασία | επεξεργασία κώδικα]

Δομικά το αιθυλεξάνιο αποτελείται από τρία μέρη: δύο αιθύλια (CH3CH2) και ένα βουτυλιδένιο (>CHCH2CH2CH3).Επομένως, ο απλούστερος τρόπος παρασκευής καθαρού αιθυλεξάνιου είναι η αντίδραση ζεύγους αιθυλολίθιου και 1,1-διαλοβουτάνιου::


Παραγωγή με αντιδράσεις χωρίς αλλαγή ανθρακικής αλυσίδας[Επεξεργασία | επεξεργασία κώδικα]

Με αναγωγή αλογονούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

Με αναγωγή κατάλληλων αλογονούχων ενώαεων μπορεί να παραχθεί αιθυλεξάνιο. Π.χ. για την αναγωγή του 1-αλο-3-αιθυλεξανίου υπάρχουν οι ακόλουθες μέθοδοι[8]:

1. Με «υδρογόνο εν τω γεννάσθαι», δηλαδή μέταλλο + οξύ:

2. Με λιθιοαργιλιοϋδρίδιο (LiAlH4) ή νατριοβοριοϋδρίδιο (NaBH4)[9]:

3. Με αναγωγή των αντίστοιχων αλκυλιωδιδίων από HI[10]:

4. Με αναγωγή από μέταλλα (συνήθως λίθιο ή μαγνήσιο) και στη συνέχεια υδρόλυση των παραγόμενων οργανομεταλλικών ενώσεων[11]:


ή

5. Με αναγωγή από σιλάνιο, παρουσία τριφθοριούχου βορίου, παράγεται 2-μεθυλεπτάνιο.Π.χ.:[12]:

Με αναγωγή οξυγονούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

Με αναγωγή κατάλληλων αλδεϋδών μπορεί να παραχθεί αιθυλεξάνιο. Π.χ. από την αναγωγή της 4-αιθυλεξανάλης με υδραζίνη (NH2NH2) (Αντίδραση Wölf-Kishner)[13]:

2. Με αναγωγή των κατάλληλων κετονών μπορεί να παραχθεί αιθυλεξάνιο. Π.χ. από την αναγωγή της 4-αιθυλεξανόνης-2 (Αντίδραση Clemmensen)[14]:

Με αναγωγή θειούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

1. Με αναγωγή των κατάλληλων θειολών μπορεί να παραχθεί αιθυλεξάνιο. Π.χ. από την αναγωγή της 4-αιθυλεξανοθειόλης-1 (μέθοδος Raney)[15]:

2. Με αναγωγή των κατάλληλων θειεστέρων μπορεί να παραχθεί αιθυλεξάνιο. Π.χ. από την αναγωγή του 1-(4΄-αιθυλεπτυλοθειο)-3-αιθυλξάνιου(μέθοδος Raney)[15]:

Με καταλυτική υδρογόνωση ακόρεστων αλειφατικών υδρογονανθράκων[Επεξεργασία | επεξεργασία κώδικα]

Με καταλυτική υδρογόνωση κατάλληλων ακόρεστων αλειφατικών υδρογονανθράκων μπορεί να παραχθεί αιθυλεξάνιο. Π.χ. με καταλυτική υδρογόνωση του 4-μεθυλεξένιου-1:

Παρασκευή με αντιδράσεις αποσύνθεσης με μείωση του μήκους της ανθρακικής αλυσίδας[Επεξεργασία | επεξεργασία κώδικα]

  • Mε τη θέρμανση αΛκαλικού διαλύματος των κατάλληλων καρβοξυλικών οξέων παράγεται 4-μεθυλεπτάνιο.

Π.χ. κατάλληλο είναι το 5-αιθυλεπτανικό οξύ:

Οξείδωση[Επεξεργασία | επεξεργασία κώδικα]

1. Όπως όλα τα αλκάνια, το αιθυλεξάνιο με περίσσεια οξυγόνου καίγεται προς διοξείδιο του άνθρακα και νερό[16]:

  • Αν και η αντίδραση είναι μια έντονα εξώθερμη δεν συμβαίνει σε μέτριες θερμοκρασίες, γιατί για την έναρξή της πρέπει να υπερπηδηθεί πρώτα το εμπόδιο της διάσπασης των δεσμών C-C[17], των δεσμών C-H[18] και των δεσμών (Ο=Ο)[19] του O2:

2. Παραγωγή υδραερίου:

3. Καταλυτική οξείδωση κυρίως προς 3-αιθυλεξανόλη-3:

4. Οξείδωση με υπερμαγγανικό κάλιο προς 3-αιθυλεξανόλη-3:

Αλογόνωση [20][Επεξεργασία | επεξεργασία κώδικα]

  • Δραστικότητα των X2: F2 > Cl2 > Br2 > Ι2.
  • όπου 0<a,b,c,d,e,f<1, a + b + c + d + e + f = 0, διαφέρουν ανάλογα με το αλογόνο:
  • Τα F και Cl είναι πιο δραστικά και λιγότερο εκλεκτικά. Η αναλογία των προπυλαλογονιδίων τους εξαρτάται κυρίως πό τη στατιστική αναλογία των προς αντικατάσταση ατόμων H.
  • Ειδικά για το χλώριο θα έχουμε:
  1. Υποκατάσταση σε ένα από τα έξι (6) συνολικά άτομα υδρογόνου των ατόμων άνθρακα #1 και #2΄. Παράγεται 3-αιθυλο-1-χλωρεξάνιο: 6·1 = 6.
  2. Υποκατάσταση σε ένα από τα τέσσερα (4) άτομα υδρογόνου των ατόμων άνθρακα #2 και #1΄. Παράγεται 3-αιθυλο-2-χλωρεξάνιο: 4·3,8 = 15,2.
  3. Υποκατάσταση στο άτομο υδρογόνου του ατόμου άνθρακα #3. Παράγεται 3-αιθυλο-3-χλωρεξάνιο: 1·5 = 5.
  4. Υποκατάσταση σε ένα από τα δύο (2) άτομα υδρογόνου του ατόμου άνθρακα #4. Παράγεται 4-αιθυλο-3-χλωρεξάνιο: 2·3,8 = 7,6.
  5. Υποκατάσταση σε ένα από τα δύο (2) άτομα υδρογόνου του ατόμου άνθρακα #5. Παράγεται 4-αιθυλο-2-χλωρεξάνιο: 2·3,8 = 7,6.
  6. Υποκατάσταση σε ένα από τα τρία (3) άτομα υδρογόνου του ατόμου άνθρακα #6. Παράγεται 4-αιθυλο-1-χλωρεξάνιο: 3·1 = 3.
  • Δηλαδή το μίγμα που προκύπτει είναι: 13,5% 3-αιθυλο-1-χλωρεξάνιο, 34,2% 3-αιθυλο-2-χλωρεξάνιο, 11,2% 3-αιθυλο-3-χλωρεξάνιο,

17,1% 4-αιθυλο-3-χλωρεξάνιο, 17,1% 4-αιθυλο-2-χλωρεξάνιο και 6,8% 4-αιθυλο-1-χλωροεξάνιο.

  • Τα Br και I είναι πιο εκλεκτικά και λιγότερο δραστικά. Η αναλογία των πεντυλαλογονιδίων μεταβάλλεται προς όφελος του τριτοταγούς (αυτού που το αλογόνο συνδέεται με τριτοταγές άτομο C, δηλαδή ατόμου C ενωμένου με 3 άλλα άτομα C) 2-μεθυλοβουτυλοαλογονιδίου-2.
  • Ειδικα για το βρώμιο θα έχουμε:
  1. Υποκατάσταση σε ένα από τα έξι (6) συνολικά άτομα υδρογόνου των ατόμων άνθρακα #1 και #2΄. Παράγεται 3-αιθυλ-1-βρωμεξάνιο: 6·1 = 6.
  2. Υποκατάσταση σε ένα από τα τέσσερα (4) άτομα υδρογόνου των ατόμων άνθρακα #2 και #1΄. Παράγεται 3-αιθυλ-2-βρωμεξάνιο: 4·82 = 328.
  3. Υποκατάσταση στο άτομο υδρογόνου του ατόμου άνθρακα #3. Παράγεται 3-αιθυλο-3-βρωμεξάνιο: 1·1600 = 1600.
  4. Υποκατάσταση σε ένα από τα δύο (2) άτομα υδρογόνου του ατόμου άνθρακα #4. Παράγεται 4-αιθυλο-3-βρωμεξάνιο: 2·82 = 164.
  5. Υποκατάσταση σε ένα από τα δύο (2) άτομα υδρογόνου του ατόμου άνθρακα #5. Παράγεται 4-αιθυλο-2-βρωμεξάνιο: 2·82 = 164.
  6. Υποκατάσταση σε ένα από τα τρία (3) άτομα υδρογόνου του ατόμου άνθρακα #6. Παράγεται 4-αιθυλο-1-βρωμεξάνιο: 3·1 = 3.
  • Δηλαδή το μίγμα που προκύπτει είναι: 0,3% 3-αιθυλ-1-βρωμεξάνιο, 14,4% 3-αιθυλ-2-βρωμεξάνιο, 70,6% 3-αιθυλο-3-βρωμεξάνιο, 7,2% 4-αιθυλο-3-βρωμεξάνιο, 7,2% 4-αιθυλο-2-βρωμεξάνιο και 0,1% 4-αιθυλο-1-βρωμεξάνιο.
  • Είναι όμως πρακτικά δύσκολο να σταματήσει η αντίδραση στην παραγωγή μονοααλογονιδίων.
  • Αν χρησιμοποιηθούν ισομοριακές ποσότητες (CΗ3CH2)2CH(CH2)2CH3 και Χ2 θα παραχθεί μίγμα όλων των αλογονοπαραγώγων του (CΗ3CH2)2CH(CH2)2CH3.
  • Αν όμως χρησιμοποιηθει περίσσεια C(CΗ3CH2)2CH(CH2)2CH3, τότε η απόδοση τωμ μονοπαραγώγων αυξάνεται πολύ, λόγω της αύξησης της στατιστική πιθανότητας συνάντισης CΗ3(CΗ3CH2)2CH(CH2)2CH3 με X. σε σχέση με την πιθανότητα συνάντισης μονοπαραγώγου και X., που μπορεί να οδηγήσει στην παραγωγή των υπόλοιπων X-παραγώγων.

Νίτρωση[Επεξεργασία | επεξεργασία κώδικα]

  • Αντιδρά με ατμούς HNO3 στην αέρια φάση[21]:

όπου 0<a,b,c,d,e,f<1, a + b + c + d + e + f = 1.

Παρεμβολή καρβενίων[Επεξεργασία | επεξεργασία κώδικα]

  • Τα καρβένια (π.χ. [:CH2]) μπορούν παρεμβληθούν στους δεσμούς C-H. Π.χ. έχουμε[22]:

  • Η αντίδραση είναι ελάχιστα εκλεκτική και αυτό σημαίνει ότι κατά προσέγγιση έχουμε;
  1. Παρεμβολή στους έξι (6) δεσμούς C#1,#2΄H2-H. Παράγεται 4-αιθυλεπτάνιο.
  2. Παρεμβολή στους τέσσερεις (4) δεσμούς C#2,#1΄H-H: 2. Παράγεται 3-αιθυλο-2-μεθυλεξάνιο.
  3. Παρεμβολή στο δεσμό C#3-H. Παράγεται 3-αιθυλο-3-μεθυλεξάνιο.
  4. Παρεμβολή στους δύο (2) δεσμούς C#4H-H: 2. Παράγεται 3-αιθυλο-4-μεθυλεξάνιο.
  5. Παρεμβολή στους δύο (2) δεσμούς C#5H-H: 2. Παράγεται 4-αιθυλο-2-μεθυλεξάνιο.
  6. Παρεμβολή στους τρεις (3) δεσμούς C#6H2-H. Παράγεται 3-αιθυλεπτάνιο.

Προκύπτει επομένως μίγμα 4-αιθυλεπτάνιου (~33%), 3-αιθυλο-2-μεθυλεξάνιου (~22%), 3-αιθυλο-3-μεθυλεξάνιου (~5%), 3-αιθυλο-4-μεθυλεξάνιου (~11%), 4-αιθυλο-2-μεθυλεξάνιου (~11%) και 3-αιθυλεπτάνιου (-17%).

Καταλυτική ισομερείωση[Επεξεργασία | επεξεργασία κώδικα]

To αιθυλεξάνιο μπορεί να υποστεί καταλυτική ισομερείωση προς τα ισομερή του.

Aναφορές και σημειώσεις[Επεξεργασία | επεξεργασία κώδικα]

  1. Διαδικτυακός τόπος Chemspider
  2. Διαδικτυακός τόπος ChemicalBook
  3. API Data Book Values, APIDATA.XLS
  4. Άτομο C ενωμένο με ένα (1) άλλο άτομο C.
  5. Άτομο C ενωμένο με δύο (2) άλλα άτομα C.
  6. άτομο C ενωμένο με τρία (3) άλλα άτομα C.
  7. Τα δεδομένα προέρχονται εν μέρει από το «Table of periodic properties of thw Ellements», Sagrent-Welch Scientidic Company και Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, Σελ. 34.
  8. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.2.1β
  9. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, §6.2.1α
  10. Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991, σελ.14, §1.1
  11. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.2.4α.Π.χ.:
  12. Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991, σελ. 291-293, §19.1.
  13. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.7.6β.
  14. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.7.6α
  15. 15,0 15,1 Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ.269, §11.6B7.
  16. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 155, §6.7.1, v = 8 και μετατροπή μονάδας ενέργειας σε kJ.
  17. ΔHC-C= +347 kJ/mol
  18. ΔHC-H = +415 kJ/mol
  19. ΔHO-O=+146 kJ/mol
  20. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 152, §6.7.1β.
  21. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 244 , §10.3.2.
  22. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 155, §6.7.3.

Πηγές[Επεξεργασία | επεξεργασία κώδικα]

  • Παπαγεωργίου Β.Π., “Εφαρμοσμένη Οργανική Χημεία: Άκυκλες Ενώσεις”, Εκδόσεις Παρατηρητής, Θεσσαλονίκη 1986.
  • Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982
  • Γ. Βάρβογλη, Ν. Αλεξάνδρου, Οργανική Χημεία, Αθήνα 1972
  • Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991
  • SCHAUM'S OUTLINE SERIES, ΟΡΓΑΝΙΚΗ ΧΗΜΕΙΑ, Μτφ. Α. Βάρβογλη, 1999
  • Μερικές από τις ενέργειες αντιδράσεων υπολογίστηκαν με χρήση κατάλληλου λογισμικού. Θα διασταυρωθούν και βιβλιογραφικά το συντομότερο για μεγαλύτερη ακρίβεια.