2-προπανιμίνη

Από τη Βικιπαίδεια, την ελεύθερη εγκυκλοπαίδεια
Πήδηση στην πλοήγηση Πήδηση στην αναζήτηση
2-προπανιμίνη
2-Propanimine.png
Γενικά
Όνομα IUPAC 2-προπανιμίνη
Άλλες ονομασίες Ισοπροπυλιδενιμίνη
2-ιμινοπροπάνιο
Χημικά αναγνωριστικά
Χημικός τύπος C3H7N
Μοριακή μάζα 57,0944[1]
Σύντομος
συντακτικός τύπος
CH3C(=NH)CH3
Συντομογραφίες Me2C=NH
Αριθμός CAS 38697-07-3
SMILES N=C(C)C
InChI InChI=1S/C3H7N/c1-3(2)4/h4H,1-2H3
Ισομέρεια
Ισομερή θέσης 11
Φυσικές ιδιότητες
Χημικές ιδιότητες
Εκτός αν σημειώνεται διαφορετικά, τα δεδομένα αφορούν υλικά υπό κανονικές συνθήκες περιβάλλοντος (25°C, 100 kPa).

Η προπανιμίνη-2 ή 2-ιμινοπροπάνιο ή ισοπροπυλιδενιμίνη είναι η χημική ένωση με σύντομο συντακτικό τύπο CH3C(=NH)CH3. Είναι η απλούστερη κετιμίνη. Με βάση το χημικό τύπο της, C3H7N, έχει τα ακόλουθα ένδεκα (11) ισομερή θέσης:

  1. Προπεν-1-αμίνη-1 με σύντομο συντακτικό τύπο: CH3CH=CHNH2 (σε δύο (2) γεωμετρικά ισομερή).
  2. Προπεν-2-αμίνη-1 με σύντομο συντακτικό τύπο: CH2=CHCH2NH2.
  3. Προπεναμίνη-2 με σύντομο συντακτικό τύπο: CH3C(NH2)=CH2.
  4. N-μεθυλαιθεναμίνη ή βινυλομεθυλαμίνη με σύντομο συντακτικό τύπο: CH3NHCH=CH2.
  5. Προπανιμίνη-1 με σύντομο συντακτικό τύπο: CH3CH2CH=NH.
  6. N-μεθυλαιθανιμίνη με σύντομο συντακτικό τύπο: CH3N=CHCH3.
  7. Ν-αιθυλομεθανιμίνη με σύντομο συντακτικό τύπο: CH2=NCH2CH3.
  8. Κυκλοπροπαναμίνη με σύντομο συντακτικό τύπο: Cyclopropylamine.svg.
  9. Αζετιδίνη ή επαζωπροπάνιο-1,3 με σύντομο συντακτικό τύπο Azetidine structure.svg:
  10. 2-μεθυλαζιριδίνη ή επαζωπροπάνιο-1,2 με σύντομο συντακτικό τύπο 2-methylaziridine.svg.
  11. N-μεθυλαζιριδίνη ή Ν-μεθυλεπαζαιθάνιο με σύντομο συντακτικό τύπο N-methylaziridine.svg.


Παραγωγή[Επεξεργασία | επεξεργασία κώδικα]

Από προπανόνη[Επεξεργασία | επεξεργασία κώδικα]

Με επίδραση αμμωνίας σε προπανόνη[2]:

Χημικές ιδιότητες και παράγωγα[Επεξεργασία | επεξεργασία κώδικα]

Συμπεριφορά βάσης[Επεξεργασία | επεξεργασία κώδικα]

Παράγει άλατα με οξέα. Π.χ.:

Αλκυλίωση[Επεξεργασία | επεξεργασία κώδικα]

Παράγει δευτεροταγείς ισοπροπυλιδενιμίνες με αλκυλαλογονίδια (RX). Π.χ.:

Ακυλίωση[Επεξεργασία | επεξεργασία κώδικα]

Παράγει δευτεροταγή ιμίδια με ακυλαλογονίδια (RCOX). Π.χ.:

Oξείδωση[Επεξεργασία | επεξεργασία κώδικα]

Οξειδώνεται προς 2-νιτροπροπάνιο:

Αναγωγή[Επεξεργασία | επεξεργασία κώδικα]

Ανάγεται προς προπαναμίνη-2:

Παρεμβολή καρβενίων[Επεξεργασία | επεξεργασία κώδικα]

  • Τα καρβένια (π.χ. [:CH2] (μεθυλένιο) μπορούν να παρεμβληθούν στους δεσμούς C-H, N-H και να δώσει προσθήκη στο δεσμό C=N. Π.χ. έχουμε[3]. Συγκεκριμένα έχουμε τις ακόλουθες μερικές αντιδράσεις:
  1. Παρεμβολή στους έξι (6) δεσμούς CH2-H. Παράγεται βουτανιμίνη-2.
  2. Παρεμβολή στον έναν (1) δεσμό N-H. Παράγεται N-μεθυλοπροπανιμίνη-2
  3. Προσθήκη στον έναν (1) δεσμό C=N. Παράγεται 2,2-διμεθυλαζιριδίνη.

Οπότε η συνολική αντίδραση είναι η ακόλουθη:

2,2-dimethylaziridine.png

2,2-dimethylaziridine.png

Παρατηρήσεις, υποσημειώσεις και αναφορές[Επεξεργασία | επεξεργασία κώδικα]

  1. Δικτυακός τόπος NIST
  2. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ.218, §9.6., A = H, R = CH3, Η → CH3.
  3. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ. 155, §6.7.3.

Πηγές[Επεξεργασία | επεξεργασία κώδικα]

  • Γ. Βάρβογλη, Ν. Αλεξάνδρου, Οργανική Χημεία, Αθήνα 1972
  • Α. Βάρβογλη, «Χημεία Οργανικών Ενώσεων», παρατηρητής, Θεσσαλονίκη 1991
  • SCHAUM'S OUTLINE SERIES, Οργανική Χημεία, Μτφ. Α. Βάρβογλη, 1999
  • Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982