1,2,3-προπανοτριαμίνη

Από τη Βικιπαίδεια, την ελεύθερη εγκυκλοπαίδεια
Μετάβαση σε: πλοήγηση, αναζήτηση
1,2,3-προπανοτριαμίνη
Γενικά
Όνομα IUPAC 1,2,3-προπανοτριαμίνη
Χημικά αναγνωριστικά
Χημικός τύπος C3H11N3
Μοριακή μάζα 89,13954 amu[1]
Σύντομος
συντακτικός τύπος
H2NCH2CH(NH2)CH2NH2
SMILES C(C(CN)N)N[2]
InChI InChI=1/C3H11N3/c4-1-3(6)2-5/h3H,1-2,4-6H2
PubChem CID 432418
Ισομέρεια
Ισομερή θέσης 36
Φυσικές ιδιότητες
Χημικές ιδιότητες
Επικινδυνότητα
Εκτός αν σημειώνεται διαφορετικά, τα δεδομένα αφορούν υλικά υπό κανονικές συνθήκες (25°C, 100 kPa).

Η 1,2,3-προπανοτριαμίνηείναι η τριαμίνη με σύντομο συντακτικό τύπο H2NCH2CH(NH2)CH2NH2. Συμπεριφέρεται ως ασθενής βάση, αφού είναι αμίνη.

Ιαομέρεια[Επεξεργασία | επεξεργασία κώδικα]

Με βάση το χημικό της τύπο, C3H11N3, έχει τα ακόλουθα 36 ισομερή θέσης (όχι όλα σταθερά):

  1. 1,1,1-προπανοτριαμίνη, με σύντομο συντακτικό τύπο CH3CH2C(NH2)3.
  2. 1,1,2-προπανοτριαμίνη, με σύντομο συντακτικό τύπο CH3CH(NH2)CH(NH2)2, σε δύο (2) οπτικά ισομερή.
  3. 1,1,3-προπανοτριαμίνη, με σύντομο συντακτικό τύπο H2NCH2CH2CH(NH2)2.
  4. 1,2,2-προπανοτριαμίνη, με σύντομο συντακτικό τύπο CH3C(NH2)2CH2NH2.
  5. N-μεθυλο-1,1,2-αιθανοτριαμίνη, με σύντομο συντακτικό τύπο H2NCH2CH(NH2)NHCH3, σε δύο (2) οπτικά ισομερή.
  6. N-μεθυλο-1,2,2-αιθανοτριαμίνη, με σύντομο συντακτικό τύπο (H2N)2CHCH2NHCH3.
  7. N-αμινομεθυλο-1,1-αιθανοδιαμίνη, με σύντομο συντακτικό τύπο CH3C(NH2)NHCH2NH2.
  8. N-αμινομεθυλο-1,2-αιθανοδιαμίνη, με σύντομο συντακτικό τύπο H2NCH2CΗNHCH2NH2, σε δύο (2) οπτικά ισομερή.
  9. N-αιθυλομεθανοτριαμίνη, με σύντομο συντακτικό τύπο CH3CH2ΝCH(NH2)2.
  10. N-(μεθυλαμινο)μεθυλομεθανοδιαμίνη, με σύντομο συντακτικό τύπο CH3NHCH2NH2NH2.
  11. Διμεθυλο(μεθυλαμινο)μεθανοτριαμίνη, με σύντομο συντακτικό τύπο CH3NHC(NH2)N(CH3)2.
  12. Δι(μεθυλαμινο)μεθαναμίνη, με σύντομο συντακτικό τύπο CH3NHCH(NH2)NHCH3.
  13. Τρι(μεθυλαμινο)μεθάνιο, με σύντομο συντακτικό τύπο CH3NHCH(NHCH3)NHCH3.
  14. (1-αμινοπροπυλ)υδραζίνη, με σύντομο συντακτικό τύπο CH3CH2CH(NH2)NHNH2.
  15. (2-αμινοπροπυλ)υδραζίνη, με σύντομο συντακτικό τύπο CH3CH2CH(NH2)NHNH2.
  16. (3-αμινοπροπυλ)υδραζίνη, με σύντομο συντακτικό τύπο CH3CH((NH2))CH2NHNH2, σε δύο (2) οπτικά ισομερή.
  17. 1-αμινισοπροπυλ)υδραζίνη, με σύντομο συντακτικό τύπο (CH3)2C(NH2)NHNH2.
  18. 2-αμινισοπροπυλ)υδραζίνη, με σύντομο συντακτικό τύπο CH3CH(CH2NH2)NHNH2, σε δύο (2) οπτικά ισομερή.
  19. 1-(1΄-αμιναιθυλ)-1-μεθυλυδραζίνη, με σύντομο συντακτικό τύπο CH3CH(NH2)N(CH3)NH2, σε δύο (2) οπτικά ισομερή.
  20. 1-(2΄-αμιναιθυλ)-1-μεθυλυδραζίνη, με σύντομο συντακτικό τύπο H2NCH2CH2N(CH3)NH2.
  21. 1-(1΄-αμιναιθυλ)-2-μεθυλυδραζίνη, με σύντομο συντακτικό τύπο CH3CH(NH2)NΗNHCH3, σε δύο (2) οπτικά ισομερή.
  22. 1-(2΄-αμιναιθυλ)-2-μεθυλυδραζίνη, με σύντομο συντακτικό τύπο H2NCH2CH2NHNHCH3.
  23. 1-αιθυλο-1-αμινομεθυλυδραζίνη, με σύντομο συντακτικό τύπο CH3CH2Ν(CH2NH2)NH2.
  24. 2-αιθυλο-1-αμινομεθυλυδραζίνη, με σύντομο συντακτικό τύπο CH3CH2ΝHNHCH2NH2.
  25. 1-μεθυλαμιναιθυλυδραζίνη, με σύντομο συντακτικό τύπο CH3C(NHCH3)NHNH2.
  26. 2-μεθυλαμιναιθυλυδραζίνη, με σύντομο συντακτικό τύπο CH3NHCH2CH2NHNH2.
  27. Αιθυλαμινομεθυλυδραζίνη, με σύντομο συντακτικό τύπο CH3CH2NHCH2NHNH2.
  28. 1,2-διμεθυλο-1-αμινομεθυλυδραζίνη, με σύντομο συντακτικό τύπο H2NCH2N(CH3)NHCH3.
  29. 1,1-διμεθυλο-2-αμινομεθυλυδραζίνη, με σύντομο συντακτικό τύπο H2NCH2NHN(CH3)2.
  30. 1-μεθυλο-1-μεθυλαμινομεθυλυδραζίνη, με σύντομο συντακτικό τύπο H2NΝ(CH3)CH2NHCH3.
  31. 2-μεθυλο-1-μεθυλαμινομεθυλυδραζίνη, με σύντομο συντακτικό τύπο CH3NHΝHCH2NHCH3.
  32. Διμεθυλαμινομεθυλυδραζίνη, με σύντομο συντακτικό τύπο (CH3)2NCH2NHNH2.
  33. 1-προπυλοτριαζάνιο, με σύντομο συντακτικό τύπο CH3CH2CH2NHNHNH2.
  34. 1-ισοπροπυλοτριαζάνιο, με σύντομο συντακτικό τύπο (CH3)2CHNHNHNH2.
  35. 2-προπυλοτριαζάνιο, με σύντομο συντακτικό τύπο CH3CH2CH2N(NH2)2.
  36. 2-ισοπροπυλοτριαζάνιο, με σύντομο συντακτικό τύπο (CH3)2CHN(NH2)2.

Ονοματολογία[Επεξεργασία | επεξεργασία κώδικα]

Η ονομασία «1,2,3-προπανοτριαμίνη» προέρχεται από την ονοματολογία κατά IUPAC. Συγκεκριμένα, το πρόθεμα «προπ-» δηλώνει την παρουσία τριών (3) ατόμων άνθρακα ανά μόριο της ένωσης, το ενδιάμεσο «-αν-» δείχνει την παρουσία μόνο απλών δεσμών μεταξύ ατόμων άνθρακα στο μόριο και η κατάληξη «-τριαμίνη» φανερώνει ότι περιέχει τρεις (3) αμινομάδες ως κύριες χαρακτηριστικές ομάδες. Οι αριθμοί θέσης «1,2,3-» δηλώνουν τις θέσεις των ατόμων άνθρακα με τα οποία ενώνονται οι αμινομάδες, ώστε να διαχωρίζονται ισομερή θέσης, που θα είχαν όμοια ονομασία.

Δομή[Επεξεργασία | επεξεργασία κώδικα]

Η δομή της μπορεί να βρεθεί αν αντικατασταθεί ένα άτομο υδρογόνου από ένα μόριο αμμωνίας με προπύλιο.

Δεσμοί[3]
Δεσμός τύπος δεσμού ηλεκτρονική δομή Μήκος δεσμού Ιονισμός
C-H σ 2sp3-1s 109 pm 3% C- H+
C-C σ 2sp3-2sp3 154 pm
C-N σ 2sp3-2sp3 152 pm 6% C+ Ν-
Ν-H σ 2sp3-1s 101,7 pm 17% N- H+
Κατανομή φορτίων
σε ουδέτερο μόριο
N -0,40
C#1,#3 0,00
C#2 +0,03
H(C-H) +0,03
H(NH2) +0,17

Παραγωγή[Επεξεργασία | επεξεργασία κώδικα]

Με γλυκερίνη και χλωριούχο αμμώνιο[Επεξεργασία | επεξεργασία κώδικα]

Η 1,2,3-προπανοτριαμίνη μπορεί να παραχθεί με επίδραση χλωριούχου αμμωνίου (NH4Cl) σε γλυκερίνη με την παρουσία τριχλωριούχου σιδήρου ως καταλύτη[4]:

  • Συμπαρασκευάζονται και άλλα παράγωγα.

Με χλωριούχο αμμώνιο και οξοπροπανοδιάλη[Επεξεργασία | επεξεργασία κώδικα]

Mε επίδραση αμμωνίας σε οξοπροπανοδιάλη παράγεται αρχικά 1,2,3-προπανοτριιμίνη και στη συνέχεια υδρογόνωση της τελευταίας 1,2,3-προπανοτριαμίνη. Marvel, C. S.; Jenkins, R. L. (1941), «Methylamine Hydrochloride», Org. Synth., http://www.orgsyn.org/orgsyn/orgsyn/prepContent.asp?prep=cv1p0347 ; Coll. Vol. 1: 347 </ref>:

Με αμμωνία και προπυλαλογονίδιο[Επεξεργασία | επεξεργασία κώδικα]

Με επίδραση αμμωνίας (NH3) σε 1,2,3-τριαλοπροπάνιο, μέθοδος Hofmann)[5]:

  • Συμπαρασκευάζονται και άλλα παράγωγα.

Με αναγωγή αζωτούχων ενώσεων[Επεξεργασία | επεξεργασία κώδικα]

1. Με αναγωγή 1,2,3-νιτροπροπανίου[6]:

2. Με αναγωγή 1,2,3-προποτρανιμίνης[7]:

Σημειώσεις και παραπομπές[Επεξεργασία | επεξεργασία κώδικα]

  1. Διαδικτυακός τόπος PubChem
  2. Διαδικτυακός τόπος ChemSink
  3. Τα δεδομένα προέρχονται εν μέρει από το «Table of periodic properties of thw Ellements», Sagrent-Welch Scientidic Company και Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, Σελ. 34. Οι ηλεκτραρνητικότητες κατά Pauling, από τις οποίες υπολογίστηκε ο ιονισμός, προέρχονται από τους πίνακες δεδομένων των χημικών στοιχείων άνθρακας, υδρογόνο, οξυγόνο και άζωτο.
  4. Marvel, C. S.; Jenkins, R. L. (1941), «Methylamine Hydrochloride», Org. Synth., http://www.orgsyn.org/orgsyn/orgsyn/prepContent.asp?prep=cv1p0347 ; Coll. Vol. 1: 347 
  5. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ.243, §10.2Α.
  6. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ.243, §10.2B2α και σελ. 247, §10.6.4α.
  7. Ασκήσεις και προβλήματα Οργανικής Χημείας Ν. Α. Πετάση 1982, σελ.243, §10.2B2δ.

Πηγές[Επεξεργασία | επεξεργασία κώδικα]

  1. SCHAUM'S OUTLINE SERIES, «ΟΡΓΑΝΙΚΗ ΧΗΜΕΙΑ», Μτφ. Α. Βάρβογλη, 1999
  2. «Ασκήσεις και προβλήματα Οργανικής Χημείας» Ν. Α. Πετάση 1982
  3. Αναστάσιου Βάρβογλη, «Χημεία Οργανικών Ενώσεων», Παρατηρητής, Θεσσαλονίκη 1991
  4. Καραγκιοζίδη Σ. Πολυχρόνη, «Ονοματολογία Οργανικών Ενώσεων στα Ελληνικά & Αγγλικά» Β΄ ΈκδοσηΘεσσαλονίκη 1991
  5. Νικολάου Ε. Αλεξάνδρου, «Γενική Οργανική Χημεία», Εκδόσεις Ζήτη, Θεσσαλονίκη 1985
  6. Δημητρίου Ν. Νικολαΐδη, «Ειδικά Μαθήματα Οργανικής Χημείας», ΑΠΘ, θεσσαλονίκη 1983
  7. Νικολάου Ε. Αλεξάνδρου, Αναστάσιου Βάρβογλη, Φαίδωνα Χατζημηχαλάκη, «Εργαστηριακός Οδηγός», Εκδόσεις Ζήτη, Θεσσαλονίκη 1986
  8. Νικολάου Ε. Αλεξάνδρου, Αναστάσιου Βάρβογλη, Δημητρίου Ν. Νικολαΐδη: «Χημεία Ετεροκυκλικών Ενώσεων», Εκδόσεις Ζήτη, Θεσσαλονίκη 1985